CAS 4838-35-1
:ethyl N-(phenylacetyl)glycinate
Description:
Ethyl N-(phenylacetyl)glycinate, with the CAS number 4838-35-1, is an organic compound that belongs to the class of amino acid derivatives. It features a glycine backbone, where the amino group is substituted with an ethyl ester and a phenylacetyl group. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in organic solvents such as ethanol and chloroform, but has limited solubility in water. Ethyl N-(phenylacetyl)glycinate is often studied for its potential applications in pharmaceuticals, particularly as an intermediate in the synthesis of various bioactive compounds. Its structure allows for interactions that may influence biological activity, making it of interest in medicinal chemistry. Additionally, it may exhibit properties such as moderate stability under standard conditions, but like many organic compounds, it should be handled with care to avoid degradation or unwanted reactions. Overall, its unique structure and properties make it a valuable compound in chemical research and development.
Formula:C12H15NO3
InChI:InChI=1/C12H15NO3/c1-2-16-12(15)9-13-11(14)8-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,13,14)
SMILES:CCOC(=O)CN=C(Cc1ccccc1)O
Synonyms:- glycine, N-(2-phenylacetyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
