CAS 4839-46-7
:3,3-Dimethylglutaric acid
Description:
3,3-Dimethylglutaric acid is a branched-chain dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) and two methyl groups attached to the central carbon chain. It is a colorless, crystalline solid at room temperature and is soluble in water and organic solvents, which enhances its utility in various chemical applications. The presence of multiple functional groups allows for diverse reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and polymers. Its molecular structure contributes to its unique properties, including its ability to participate in esterification and amidation reactions. Additionally, 3,3-Dimethylglutaric acid can be involved in metabolic pathways, particularly in the context of certain metabolic disorders. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to mitigate any potential risks associated with exposure. Overall, its chemical characteristics make it a valuable compound in both industrial and research settings.
Formula:C7H12O4
InChI:InChI=1S/C7H12O4/c1-7(2,3-5(8)9)4-6(10)11/h3-4H2,1-2H3,(H,8,9)(H,10,11)
InChI key:InChIKey=DUHQIGLHYXLKAE-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)(C)C)C(O)=O
Synonyms:- 2,2-Dimethylpropane-1,3-dicarboxylic acid
- 3,3-Dimethyl-Pentanedioicaci
- 3,3-Dimethylpentanedioate
- 3,3-Dimethylpentanedioic acid
- Glutaric acid, 3,3-dimethyl-
- Glutaric acid, β,β-dimethyl-
- NSC 14987
- NSC 49114
- Pentanedioic acid, 3,3-dimethyl-
- β,β-Dimethylglutaric acid
- 3,3-Dimethylglutaric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
3,3-Dimethylglutaric acid, 98+%
CAS:It acts as a reactant involved in cyclodehydration of diols, synthesis of conjugates of betulin derivatives used as anti-HIV agents, preparation of dimeric peptide antagonists of IgG-FcRn interaction, microwave-assisted protection of glutaraldehyde, synthesis of glycyrrhetinic acid derivatives forFormula:C7H12O4Purity:98+%Color and Shape:Crystals or Crystalline powder, White to creamMolecular weight:160.173,3-DIMETHYLPENTANEDIOIC ACID
CAS:Formula:C7H12O4Purity:97%Color and Shape:SolidMolecular weight:160.16783,3-Dimethylglutaric Acid
CAS:Formula:C7H12O4Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:160.173,3-Dimethylglutaric acid
CAS:3,3-Dimethylglutaric acid (3,3-Dimethylpentanedioate) is a compound found in human urine.Formula:C7H12O4Purity:99.13%Color and Shape:SolidMolecular weight:160.173,3-Dimethylglutaric acid
CAS:3,3-Dimethylglutaric acid is an organic compound that is the product of cationic polymerization. It is a malonic acid derivative, meaning it contains a carboxyl group and two hydroxyl groups. 3,3-Dimethylglutaric acid has been shown to be resistant against many chemical reactions and can be used as a catalyst for the synthesis of high molecular weight polymers. The molecular structure of this compound was determined using X-ray crystallography and found to be composed of alternating methylene (CH2) and carbonate (CO) groups. This compound also inhibits methyltransferase enzymes in human liver cells, which are responsible for the production of cholesterol.Formula:C7H12O4Color and Shape:White Off-White PowderMolecular weight:160.17 g/mol3,3-Dimethylglutaric Acid
CAS:Controlled ProductFormula:C7H12O4Color and Shape:NeatMolecular weight:160.17








