CAS 483968-39-4

N,N-diethyl-9-oxobicyclo[3.3.1]nonane-3-carboxamide

Description:

N,N-Diethyl-9-oxobicyclo[3.3.1]nonane-3-carboxamide is a bicyclic compound characterized by its unique structural framework, which includes a bicyclo[3.3.1]nonane core. This compound features a ketone functional group (the oxo group) at the 9-position and an amide group at the 3-position, with two ethyl groups attached to the nitrogen atom of the amide. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including medicinal chemistry and organic synthesis. The bicyclic structure imparts rigidity, which can influence the compound's biological activity and interaction with other molecules. Additionally, the compound's solubility, stability, and reactivity can vary based on the surrounding environment and conditions. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound may not be fully characterized. Overall, N,N-diethyl-9-oxobicyclo[3.3.1]nonane-3-carboxamide represents a complex and interesting structure within organic chemistry.

Formula: C₁₄H₂₃NO₂

InChI: InChI=1/C14H23NO2/c1-3-15(4-2)14(17)12-8-10-6-5-7-11(9-12)13(10)16/h10-12H,3-9H2,1-2H3

SMILES: CCN(CC)C(=O)C1CC2CCCC(C1)C2=O

N,N-diethyl-9-oxobicyclo[3.3.1]nonane-3-carboxamide

CAS: 483968-39-4

Purity: 95.0%

Molecular weight: 237.34300231933594

Ref: 10-F315260