CAS 484-66-2: 2,3,4,5,6-Pentamethylbenzenemethanol

Description:2,3,4,5,6-Pentamethylbenzenemethanol, with the CAS number 484-66-2, is an organic compound characterized by a complex structure that includes a benzene ring substituted with five methyl groups and a hydroxymethyl group. This compound is a derivative of toluene, where the presence of multiple methyl groups enhances its hydrophobic properties and influences its reactivity. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the hydroxymethyl group introduces potential for hydrogen bonding, which can affect its solubility in various solvents. The compound is likely to exhibit low volatility and moderate stability under standard conditions. Its chemical properties may include reactivity towards electrophiles due to the electron-donating effects of the methyl groups. Additionally, it may find applications in organic synthesis, as a building block for more complex molecules, or in the formulation of specialty chemicals. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₁₂H₁₈O

InChI:InChI=1S/C12H18O/c1-7-8(2)10(4)12(6-13)11(5)9(7)3/h13H,6H2,1-5H3

InChI key:InChIKey=CMBCAWNOBIGGTE-UHFFFAOYSA-N

SMILES:OCC=1C(=C(C(=C(C1C)C)C)C)C