CAS 484-74-2

Isodictamnine

Description:

Isodictamnine is a naturally occurring alkaloid primarily derived from the plant species *Dictamnus dasycarpus*, commonly known for its traditional medicinal uses. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Isodictamnine exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. The substance is typically found in the form of a crystalline solid and is soluble in organic solvents, which facilitates its extraction and purification from plant sources. Its chemical behavior is influenced by its functional groups, allowing it to participate in various chemical reactions. As with many alkaloids, isodictamnine's effects on biological systems are mediated through interactions with specific receptors or enzymes, highlighting its potential therapeutic applications. However, further research is necessary to fully elucidate its mechanisms of action and to assess its safety and efficacy in clinical settings.

Formula: C₁₂H₉NO₂

InChI: InChI=1S/C12H9NO2/c1-13-10-5-3-2-4-8(10)11(14)9-6-7-15-12(9)13/h2-7H,1H3

InChI key: InChIKey=FUVCJKNEOUWLPI-UHFFFAOYSA-N

SMILES: O=C1C2=C(N(C)C=3C1=CC=CC3)OC=C2

Synonyms:

• Isodictamine
• Isodictamnine
• furo[2,3-b]quinolin-4(9H)-one, 9-methyl-
• 9-Methylfuro[2,3-b]quinolin-4(9H)-one

Isodictamnine

CAS: 484-74-2

Isodictamnine is phototoxic to certain bacteria and yeasts in long wave UV light.

Formula: C₁₂H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.21

Ref: TM-TN4280

Isodictamnine

CAS: 484-74-2

Formula: C₁₂H₉NO₂

Purity: 95%~99%

Molecular weight: 199.209

Ref: BP-SBP03471

Isodictamnine

CAS: 484-74-2

Isodictamnine is a natural alkaloid, which is derived from plant sources, specifically in certain species of the Rutaceae family. Its mode of action involves the modulation of various biochemical pathways that are crucial in cellular processes. This compound has shown diverse biological activities, such as anti-inflammatory and anticancer properties, through the inhibition of specific enzymes and modulation of signal transduction pathways.

Formula: C₁₂H₉NO₂

Purity: Min. 95%

Molecular weight: 199.2 g/mol

Ref: 3D-AAA48474