CAS 4843-44-1
:3-(2-Thienyl)-2-propynoic acid
Description:
3-(2-Thienyl)-2-propynoic acid is an organic compound characterized by its unique structure, which includes a thienyl group and a propynoic acid moiety. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity. This compound features a triple bond between the second and third carbon atoms of the propynoic acid, which imparts significant acidity and reactivity, particularly in nucleophilic addition reactions. The presence of the carboxylic acid functional group (-COOH) enhances its solubility in polar solvents and allows for hydrogen bonding, influencing its physical properties. 3-(2-Thienyl)-2-propynoic acid may exhibit biological activity, making it of interest in medicinal chemistry and material science. Its molecular structure allows for potential applications in organic synthesis and as a building block for more complex molecules. Overall, this compound exemplifies the interplay between aromaticity, acidity, and reactivity in organic chemistry.
Formula:C7H4O2S
InChI:InChI=1S/C7H4O2S/c8-7(9)4-3-6-2-1-5-10-6/h1-2,5H,(H,8,9)
InChI key:InChIKey=XOLCGOHVBZMILJ-UHFFFAOYSA-N
SMILES:C(#CC(O)=O)C1=CC=CS1
Synonyms:- (2-Thienyl)propiolic acid
- 3-(2-Thienyl)propiolic acid
- 2-Thiophenepropiolic acid
- 3-(2-Thienyl)-2-propynoic acid
- 2-Propynoic acid, 3-(2-thienyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(thiophen-2-yl)prop-2-ynoic acid
CAS:Formula:C7H4O2SPurity:97%Color and Shape:SolidMolecular weight:152.17053-(Thiophen-2-yl)prop-2-ynoic acid
CAS:3-(Thiophen-2-yl)prop-2-ynoic acid
Purity:95%Molecular weight:152.17g/mol3-(thiophen-2-yl)prop-2-ynoic acid
CAS:Formula:C7H4O2SPurity:95.0%Color and Shape:Liquid, No data available.Molecular weight:152.173-(Thiophen-2-yl)prop-2-ynoic acid
CAS:3-(Thiophen-2-yl)prop-2-ynoic acid is an initiator for the oxidation of organic substances. It can undergo oxidation to form reactive intermediates that react with other molecules to produce new substances. This reaction is catalyzed by copper, which oxidizes 3-(thiophen-2-yl)prop-2-ynoic acid in a two step process. The first step involves formation of a peroxide intermediate, which reacts with a second molecule of 3-(thiophen-2-yl)prop-2-ynoic acid to form an alkenyl radical. The alkenyl radical reacts with another molecule of 3-(thiophen-2-yl)prop-2-ynoic acid to generate a 2,3,5,6 tetraene compound. The mechanism for this reaction is not well understood but it has been shown that it occurs in nature and is important in biomolecular chemistry.Formula:C7H4O2SPurity:Min. 95%Molecular weight:152.17 g/mol



