CAS 485-61-0

Graveoline

Description:

Graveoline, with the CAS number 485-61-0, is a chemical compound classified as an alkaloid, specifically derived from certain plant species. It is known for its complex bicyclic structure, which contributes to its unique chemical properties. Graveoline exhibits a range of biological activities, including potential anti-inflammatory and analgesic effects, making it of interest in pharmacological research. The compound is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many alkaloids. Its molecular structure includes nitrogen atoms, which are integral to its reactivity and interaction with biological systems. Additionally, graveoline may undergo various chemical reactions, such as oxidation or reduction, depending on the conditions it is exposed to. As with many alkaloids, caution is advised when handling graveoline due to its potential toxicity and the need for proper safety measures in laboratory settings. Overall, graveoline represents a fascinating subject for further study in both organic chemistry and medicinal applications.

Formula: C₁₇H₁₃NO₃

InChI: InChI=1S/C17H13NO3/c1-18-13-5-3-2-4-12(13)15(19)9-14(18)11-6-7-16-17(8-11)21-10-20-16/h2-9H,10H2,1H3

InChI key: InChIKey=COBBNRKBTCBWQP-UHFFFAOYSA-N

SMILES: CN1C(=CC(=O)C=2C1=CC=CC2)C=3C=C4C(=CC3)OCO4

Synonyms:

• 4(1H)-Quinolone, 1-methyl-2-[3,4-(methylenedioxy)phenyl]-
• 4(1H)-Quinolinone, 2-(1,3-benzodioxol-5-yl)-1-methyl-
• Graveoline
• Rutamine
• 2-(1,3-Benzodioxol-5-yl)-1-methyl-4(1H)-quinolinone

Graveoline

CAS: 485-61-0

Formula: C₁₇H₁₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 279.2900

Ref: IN-DA006WPU

Graveoline

CAS: 485-61-0

Graveoline

Purity: 97%

Molecular weight: 279.3g/mol

Ref: 54-OR1005113

2-(Benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one

CAS: 485-61-0

Purity: 97.0%

Molecular weight: 279.2950134277344

Ref: 10-F540327

Graveoline

CAS: 485-61-0

Graveoline (2-(Benzo[d][1,3]dioxol-5-yl)-1-methylquinolin-4(1H)-one) is an apoptosis and autophagy inducer in skin melanoma cancer cells

Formula: C₁₇H₁₃NO₃

Purity: 98.14%

Color and Shape: Solid

Molecular weight: 279.29

Ref: TM-TN6705

Graveoline

CAS: 485-61-0

Graveoline is a natural product, classified as an alkaloid, which is derived from certain plant species such as Ruta graveolens. This compound is biosynthesized through a series of enzymatic processes involving key precursors typical of the benzylisoquinoline alkaloid pathway. The mode of action of Graveoline involves interacting with various biological targets, potentially including binding sites on proteins or influencing signaling pathways, thereby exhibiting effects such as antimicrobial, antifungal, or anti-inflammatory activities.

Formula: C₁₇H₁₃NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 279.29 g/mol

Ref: 3D-AAA48561

Graveoline

Controlled Product

CAS: 485-61-0

Applications Graveoline is an apoptosis and autophagy inducer in skin melanoma cancer cells.

Formula: C₁₇H₁₃NO₃

Color and Shape: Neat

Molecular weight: 279.29

Ref: TR-G780015