CAS 485-90-5
:7-hydroxy-8-methoxy-2H-chromen-2-one
Description:
7-Hydroxy-8-methoxy-2H-chromen-2-one, commonly known as 7-hydroxyflavone, is a flavonoid compound characterized by its chromone structure, which consists of a benzopyran ring system. This compound features hydroxyl (-OH) and methoxy (-OCH3) functional groups, contributing to its biological activity and solubility properties. It typically appears as a yellow to orange crystalline solid and is soluble in organic solvents like ethanol and methanol, but less soluble in water. 7-Hydroxyflavone is known for its antioxidant properties and potential health benefits, including anti-inflammatory and neuroprotective effects. It has been studied for its role in various biological systems, including its ability to modulate enzyme activity and interact with cellular signaling pathways. The compound's structure allows it to participate in various chemical reactions, making it of interest in both synthetic and natural product chemistry. Its applications extend to pharmaceuticals, nutraceuticals, and cosmetic formulations, where its beneficial properties can be harnessed.
Formula:C10H8O4
InChI:InChI=1/C10H8O4/c1-13-10-7(11)4-2-6-3-5-8(12)14-9(6)10/h2-5,11H,1H3
SMILES:COc1c(ccc2ccc(=O)oc12)O
Synonyms:- 2H-1-benzopyran-2-one, 7-hydroxy-8-methoxy-
- 7-Hydroxy-8-methoxycoumarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Hydrangetin
CAS:Hydrangetin (7-Hydroxy-8-methoxycoumarin) is a small molecule compound from Daphne papyracea var that inhibits platelet aggregation.Formula:C10H8O4Purity:99.90%Color and Shape:SolidMolecular weight:192.17Daphnetin-8-methyl ether
CAS:Daphnetin-8-methyl ether is a naturally derived coumarin compound, which is predominantly sourced from the Daphne genus of plants, among other botanical species known for their therapeutic potential. This compound is recognized for its biochemical interaction with key cellular pathways, particularly through the modulation of enzymes and receptors associated with inflammatory and oxidative stress responses.
Formula:C10H8O4Purity:Min. 95%Molecular weight:192.17 g/mol


