CAS 485339-93-3

5-[(4-methoxyphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

Description:

5-[(4-Methoxyphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a thiol group (-SH) that contributes to its reactivity and potential biological activity. The presence of a methoxyphenoxy group enhances its solubility and may influence its interaction with biological targets. The methyl group at the 4-position of the triazole ring can affect the compound's steric and electronic properties, potentially impacting its pharmacological profile. This substance may exhibit various biological activities, including antifungal or antimicrobial properties, due to the presence of the triazole and thiol functionalities. Its unique structure allows for potential applications in medicinal chemistry and agricultural chemistry. As with many triazole derivatives, it may also serve as a scaffold for the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₃N₃O₂S

InChI: InChI=1/C11H13N3O2S/c1-14-10(12-13-11(14)17)7-16-9-5-3-8(15-2)4-6-9/h3-6H,7H2,1-2H3,(H,13,17)

SMILES: Cn1c(COc2ccc(cc2)OC)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-[(4-methoxyphenoxy)methyl]-4-methyl-

5-[(4-methoxyphenoxy)methyl]-4-methyl-4H-1,2,4-triazole-3-thiol

CAS: 485339-93-3

Formula: C₁₁H₁₃N₃O₂S

Purity: 95.0%

Molecular weight: 251.3

Ref: 10-F307775