CymitQuimica logo

CAS 4858-29-1

:

5-(Octylthio)-1,3,4-thiadiazole-2(3H)-thione

Description:
5-(Octylthio)-1,3,4-thiadiazole-2(3H)-thione is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features an octylthio group, contributing to its hydrophobic properties and potentially influencing its solubility and reactivity. The thiadiazole structure is known for its biological activity, making such compounds of interest in pharmaceuticals and agrochemicals. The thione functional group indicates the presence of a sulfur atom double-bonded to a carbon atom, which can enhance the compound's reactivity and stability. Typically, compounds like this may exhibit properties such as antimicrobial, antifungal, or herbicidal activities, depending on their specific structure and substituents. Additionally, the presence of the octyl chain may affect the compound's lipophilicity, influencing its interaction with biological membranes. Overall, 5-(Octylthio)-1,3,4-thiadiazole-2(3H)-thione is a versatile compound with potential applications in various fields, including materials science and medicinal chemistry.
Formula:C10H18N2S3
InChI:InChI=1S/C10H18N2S3/c1-2-3-4-5-6-7-8-14-10-12-11-9(13)15-10/h2-8H2,1H3,(H,11,13)
InChI key:InChIKey=SGPWFGFUABWPHC-UHFFFAOYSA-N
SMILES:S(CCCCCCCC)C1=NNC(=S)S1
Synonyms:
  • 1,3,4-Thiadiazole-2-thiol, 5-(octylthio)-
  • 2-Mercapto-5-octylthio-1,3,4-thiadiazole
  • 5-(Octylthio)-1,3,4-thiadiazole-2(3H)-thione
  • 1,3,4-Thiadiazole-2(3H)-thione, 5-(octylthio)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.