CAS 4858-96-2
:Choline O-sulfate
Description:
Choline O-sulfate, with the CAS number 4858-96-2, is an organic compound that features a choline moiety linked to a sulfate group. It is a quaternary ammonium compound, which means it contains a positively charged nitrogen atom bonded to four organic groups. This compound is soluble in water, making it readily bioavailable in biological systems. Choline O-sulfate plays a role in various biochemical processes, particularly in the synthesis of phospholipids and neurotransmitters, contributing to cellular membrane integrity and signaling. It is also involved in methylation reactions, which are crucial for DNA and RNA synthesis. The compound is generally recognized for its potential health benefits, including supporting cognitive function and liver health. However, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Choline O-sulfate is an important substance in both nutritional biochemistry and pharmacology, with ongoing research into its various physiological roles and therapeutic applications.
Formula:C5H13NO4S
InChI:InChI=1S/C5H13NO4S/c1-6(2,3)4-5-10-11(7,8)9/h4-5H2,1-3H3
InChI key:InChIKey=WXCQAWGXWVRCGP-UHFFFAOYSA-N
SMILES:C([N+](C)(C)C)COS(=O)(=O)[O-]
Synonyms:- 2-(Trimethylammonio)Ethyl Sulfate
- 2-(Trimethylazaniumyl)ethyl sulfate
- Choline O-sulfate
- Choline sulfate
- Choline, hydrogen sulfate
- Choline, hydroxide, hydrogen sulfate, inner salt
- Ethanaminium, N,N,N-trimethyl-2-(sulfooxy)-, inner salt
- N,N,N-trimethyl-2-(sulfooxy)ethanaminium
- NSC 46242
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cholinesulfuric acid.
CAS:Cholinesulfuric acid. is a useful organic compound for research related to life sciences. The catalog number is T124793 and the CAS number is 4858-96-2.Formula:C5H13NO4SColor and Shape:SolidMolecular weight:183.22
