CAS 486-21-5: Isofraxidin
Description:Isofraxidin, with the CAS number 486-21-5, is a chemical compound classified as a flavonoid, specifically a methoxyflavone. It is primarily derived from various plant sources, particularly from the roots of certain species in the genus *Angelica*. Isofraxidin is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and vasodilatory effects. The compound exhibits a yellowish crystalline appearance and is soluble in organic solvents, such as ethanol and methanol, but has limited solubility in water. Isofraxidin has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in cardiovascular health and as a natural remedy in traditional medicine. Its mechanism of action may involve the modulation of various biochemical pathways, contributing to its beneficial effects. However, further research is necessary to fully elucidate its pharmacokinetics, safety profile, and efficacy in clinical settings.
Formula:C11H10O5
InChI:InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)11(15-2)9(7)13/h3-5,13H,1-2H3
InChI key:InChIKey=HOEVRHHMDJKUMZ-UHFFFAOYSA-N
SMILES:O=C1OC=2C(OC)=C(O)C(OC)=CC2C=C1
- Synonyms:
- 2H-1-Benzopyran-2-one, 7-hydroxy-6,8-dimethoxy-
- 6,8-Dimethoxy-7-hydroxycoumarin
- 7-Hydroxy-6,8-dimethoxy-2H-1-benzopyran-2-one
- 7-Hydroxy-6,8-dimethoxychromen-2-one
- 7-hydroxy-6,8-dimethoxy-2H-chromen-2-one
- Coumarin, 7-hydroxy-6,8-dimethoxy-
- NSC 324637
- Phytodolor
- Umbelliferone, 6,8-dimethoxy-
- Isofraxidin
- See more synonyms
