CAS 486-21-5
:Isofraxidin
Description:
Isofraxidin, with the CAS number 486-21-5, is a chemical compound classified as a flavonoid, specifically a methoxyflavone. It is primarily derived from various plant sources, particularly from the roots of certain species in the genus *Angelica*. Isofraxidin is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and vasodilatory effects. The compound exhibits a yellowish crystalline appearance and is soluble in organic solvents, such as ethanol and methanol, but has limited solubility in water. Isofraxidin has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in cardiovascular health and as a natural remedy in traditional medicine. Its mechanism of action may involve the modulation of various biochemical pathways, contributing to its beneficial effects. However, further research is necessary to fully elucidate its pharmacokinetics, safety profile, and efficacy in clinical settings.
Formula:C11H10O5
InChI:InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)11(15-2)9(7)13/h3-5,13H,1-2H3
InChI key:InChIKey=HOEVRHHMDJKUMZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=CC(OC)=C1O)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 7-hydroxy-6,8-dimethoxy-
- 6,8-Dimethoxy-7-hydroxycoumarin
- 7-Hydroxy-6,8-dimethoxy-2H-1-benzopyran-2-one
- 7-Hydroxy-6,8-dimethoxychromen-2-one
- 7-hydroxy-6,8-dimethoxy-2H-chromen-2-one
- Coumarin, 7-hydroxy-6,8-dimethoxy-
- NSC 324637
- Phytodolor
- Umbelliferone, 6,8-dimethoxy-
- Isofraxidin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
7-Hydroxy-6,8-dimethoxy-2H-1-benzopyran-2-one
CAS:Formula:C11H10O5Purity:99%Color and Shape:SolidMolecular weight:222.19417-Hydroxy-6,8-Dimethoxy-2H-Chromen-2-One
CAS:7-Hydroxy-6,8-Dimethoxy-2H-Chromen-2-OnePurity:99%Molecular weight:222.19g/molIsofraxidin
CAS:Isofraxidin has definite anti-bacterial, anti-oxidant, analgesic,and anti-inflammatory activities, it inhibits expression of MMP-7 and in vitro cell invasion at a non-toxic level through inhibiting ERK1/2 phosphorylation in hepatoma cell lines.Isofraxidin is one possible radio-protector, it can protect leukemia cells from radiation-induced apoptosis via ROS/mitochondria pathway in a p53-independent manner.Formula:C11H10O5Purity:95%~99%Molecular weight:222.196Isofraxidin
CAS:Isofraxidin combats leukemia, ALI, and inflammation by modulating ROS, COX-2, PGE2, TNF-α, and p38/ERK1/2 pathways.Formula:C11H10O5Purity:99.51% - ≥95%Color and Shape:SolidMolecular weight:222.19Isofraxidin
CAS:LactoneFormula:C11H10O5Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:222.2Isofraxidin
CAS:Isofraxidin is a natural compound, classified as a coumarin, which is derived from a variety of plant species, including certain members of the Artemisia or Acanthopanax genus. Its chemical structure is characterized by a 7-hydroxy-6,8-dimethoxy derivative that contributes to its pharmacological properties.Formula:C11H10O5Purity:Min. 95%Color and Shape:PowderMolecular weight:222.19 g/mol







