
CAS 486-23-7
:Leptosin
Description:
Leptosin, with the CAS number 486-23-7, is a chemical compound classified as a natural product, specifically a type of glycoside. It is derived from certain plant sources and is known for its potential biological activities, including antimicrobial and antifungal properties. Leptosin typically exhibits a complex structure that includes sugar moieties linked to aglycone components, which contribute to its pharmacological effects. The compound is often studied for its interactions with biological systems, particularly in the context of traditional medicine and natural product chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and potential therapeutic uses. As with many natural compounds, the extraction and purification processes are crucial for obtaining leptosin in a usable form for further study or application. Overall, leptosin represents an interesting subject of study within the field of natural products and medicinal chemistry.
Formula:C22H22O11
InChI:InChI=1S/C22H22O11/c1-30-21-13(32-22-19(29)18(28)17(27)15(8-23)33-22)5-3-10-16(26)14(31-20(10)21)7-9-2-4-11(24)12(25)6-9/h2-7,15,17-19,22-25,27-29H,8H2,1H3
InChI key:InChIKey=NXOKVARAWXQHGX-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(=O)C(=CC3=CC(O)=C(O)C=C3)O2)=CC=C1OC4OC(CO)C(O)C(O)C4O
Synonyms:- Leptosin
- 3(2H)-Benzofuranone, 2-[(3,4-dihydroxyphenyl)methylene]-6-(β-D-glucopyranosyloxy)-7-methoxy-, (2Z)-
- (2Z)-2-[(3,4-Dihydroxyphenyl)methylene]-6-(β-D-glucopyranosyloxy)-7-methoxy-3(2H)-benzofuranone
- 3(2H)-Benzofuranone, 2-[(3,4-dihydroxyphenyl)methylene]-6-(β-D-glucopyranosyloxy)-7-methoxy-, (Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
