CAS 486-62-4: Ononin
Description:Ononin, with the CAS number 486-62-4, is a naturally occurring isoflavonoid primarily found in various plants, particularly in legumes and certain medicinal herbs. It is a glycoside of the isoflavone formononetin, meaning it consists of a sugar moiety attached to the isoflavone structure. Ononin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential estrogenic effects, which have garnered interest in the fields of pharmacology and nutrition. The compound is often studied for its potential health benefits, including its role in hormone regulation and its implications in various diseases. Ononin is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many isoflavonoids. Its structural properties contribute to its biological activity, making it a subject of research in both natural product chemistry and medicinal applications.
Formula:C22H22O9
InChI:InChI=1S/C22H22O9/c1-28-12-4-2-11(3-5-12)15-10-29-16-8-13(6-7-14(16)18(15)24)30-22-21(27)20(26)19(25)17(9-23)31-22/h2-8,10,17,19-23,25-27H,9H2,1H3/t17-,19-,20+,21-,22-/m1/s1
InChI key:InChIKey=MGJLSBDCWOSMHL-MIUGBVLSSA-N
SMILES:O=C1C(=COC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC=C12)C=4C=CC(OC)=CC4
- Synonyms:
- 3-(4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 4'-Methoxyisoflavone-7-O-beta-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 7-(beta-D-glucopyranosyloxy)-3-(4-methoxyphenyl)-
- 4H-1-Benzopyran-4-one, 7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3-(4-methoxyphenyl)-
- 7-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
- 7-(β-Glucosyloxy)-3-(4-methoxyphenyl)isoflavone
- 7-Hydroxy-4′-methoxyisoflavone-7-O-β-<span class="text-smallcaps">D</span>-glucoside
- Formononetin 7-O-glucoside
- Formononetin 7-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Formononetin 7-O-β-<span class="text-smallcaps">D</span>-glucoside
- See more synonyms
- Formononetin 7-glucoside
- Formononetin 7β-<span class="text-smallcaps">D</span>-glucopyranoside
- Formononetin glucoside
- Formononetin-7-O-beta-D-glucopyranoside
- Formononetin-7-O-β-<span class="text-smallcaps">D</span>-glycoside
- Ononoside
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-3-(4-methoxyphenyl)-
- Ononin
- Formononetin 7-O-β-D-glucopyranoside
- 7-(β-D-Glucopyranosyloxy)-3-(4-methoxyphenyl)-4H-1-benzopyran-4-one
