CAS 486-63-5
:Isoformononetin
Description:
Isoformononetin, with the CAS number 486-63-5, is a naturally occurring isoflavonoid compound primarily found in various plants, particularly in legumes and certain medicinal herbs. It is characterized by its phenolic structure, which contributes to its antioxidant properties. Isoformononetin exhibits a range of biological activities, including potential anti-inflammatory, anti-cancer, and estrogenic effects, making it of interest in pharmacological research. The compound is typically a yellowish crystalline solid, and its solubility can vary depending on the solvent used, often being more soluble in organic solvents than in water. Isoformononetin's molecular formula reflects its classification as an isoflavone, which is part of a larger group of flavonoids known for their health benefits. Its potential applications in nutraceuticals and pharmaceuticals are being explored, particularly in relation to hormone-related conditions and chronic diseases. As with many phytochemicals, further studies are necessary to fully understand its mechanisms of action and therapeutic potential.
Formula:C16H12O4
InChI:InChI=1S/C16H12O4/c1-19-12-6-7-13-15(8-12)20-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9,17H,1H3
InChI key:InChIKey=LNIQZRIHAMVRJA-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(OC)=CC2)OC=C1C3=CC=C(O)C=C3
Synonyms:- 3-(4-Hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
- 4'-Hydroxy-7-methoxyisoflavone
- Isoflavone, 4′-hydroxy-7-methoxy-
- Isoflavone,4'-hydroxy-7-methoxy- (7CI,8CI)
- Isoformonentin
- Isoformononetin
- 4H-1-Benzopyran-4-one, 3-(4-hydroxyphenyl)-7-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4''-HYDROXY-7-METHOXYISOFLAVONE
CAS:Formula:C16H12O4Purity:99%Color and Shape:SolidMolecular weight:268.2641Isoformononetin
CAS:Isoformononetin (IFN) is a methoxy isoflavone present in human dietary supplements with immune-protective effects.Formula:C16H12O4Purity:98%Color and Shape:SolidMolecular weight:268.26Isoformononetin
CAS:Oxygen-heterocyclic compoundFormula:C16H12O4Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:268.274'-Hydroxy-7-methoxyisoflavone
CAS:4'-Hydroxy-7-methoxyisoflavone is a naturally occurring isoflavone, which is a type of phytoestrogen found in various plants. It is synthesized typically from plant sources and is part of a broader class of compounds known for their presence in legumes, especially soy and red clover. The mode of action of 4'-Hydroxy-7-methoxyisoflavone is primarily through its interaction with estrogen receptors, where it can exhibit weak estrogenic activity. This attribute allows it to modulate estrogenic signaling pathways, influencing cellular processes related to growth and metabolism.Formula:C16H12O4Purity:Min. 95%Color and Shape:PowderMolecular weight:268.26 g/mol






