CAS 486-90-8

(-)-Thermopsine

Description:

(-)-Thermopsine, with the CAS number 486-90-8, is a naturally occurring alkaloid primarily derived from the plant Thermopsis lanceolata, which is part of the legume family. This compound is characterized by its unique structural features, including a bicyclic framework that contributes to its biological activity. (-)-Thermopsine exhibits a range of pharmacological properties, including potential antitumor and anti-inflammatory effects, making it of interest in medicinal chemistry. Its stereochemistry is significant, as the specific configuration can influence its biological interactions and efficacy. The compound is typically studied for its effects on various biological systems, and its mechanism of action may involve modulation of cellular signaling pathways. Additionally, (-)-Thermopsine's solubility and stability can vary depending on environmental conditions, which is crucial for its application in research and potential therapeutic uses. Overall, (-)-Thermopsine represents a fascinating subject of study within the field of natural products and pharmacology.

Formula: C₁₅H₂₀N₂O

InChI: InChI=1S/C15H20N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h3,5-6,11-13H,1-2,4,7-10H2/t11-,12-,13+/m1/s1

InChI key: InChIKey=FQEQMASDZFXSJI-UPJWGTAASA-N

SMILES: O=C1N2C([C@@]3(C[C@](C2)([C@]4(N(C3)CCCC4)[H])[H])[H])=CC=C1

Synonyms:

• Thermopsine
• 7,14-Methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-, [7R-(7α,14α,14aα)]-
• l-Thermopsine
• (7R,14R,14aS)-1,3,4,6,7,13,14,14a-Octahydro-7,14-methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one
• 7,14-Methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-, (7R,14R,14aS)-

Thermopsine

CAS: 486-90-8

Thermopsine

Purity: ≥98%

Molecular weight: 244.33g/mol

Ref: 54-BUP05089

Thermopsine

CAS: 486-90-8

Formula: C₁₅H₂₀N₂O

Molecular weight: 244.34

Ref: 7W-GY6625

Thermopsine

CAS: 486-90-8

Formula: C₁₅H₂₀N₂O

Purity: 95%~99%

Molecular weight: 244.338

Ref: BP-BP1391

Thermopsine

CAS: 486-90-8

1. Thermopsine (Thermospine) exhibits antibacterial activity.

Formula: C₁₅H₂₀N₂O

Purity: 99.75% - 99.83%

Color and Shape: Solid

Molecular weight: 244.33

Ref: TM-T3S0970

Thermopsine

CAS: 486-90-8

Natural alkaloid

Formula: C₁₅H₂₀N₂O

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 244.33

Ref: 5G-26626