CAS 4864-01-1

2-Methoxy-5-(trifluoromethyl)benzoic acid

Description:

2-Methoxy-5-(trifluoromethyl)benzoic acid, with the CAS number 4864-01-1, is an aromatic carboxylic acid characterized by the presence of a methoxy group (-OCH3) and a trifluoromethyl group (-CF3) on a benzene ring. This compound typically exhibits a white to off-white crystalline solid form and is known for its relatively low solubility in water, while being more soluble in organic solvents. The trifluoromethyl group imparts unique electronic properties, enhancing the compound's lipophilicity and potentially influencing its reactivity and biological activity. The presence of the carboxylic acid functional group (-COOH) allows for acidic behavior, making it capable of participating in various chemical reactions, such as esterification and amidation. Additionally, the methoxy group can influence the compound's steric and electronic properties, affecting its interactions in chemical and biological systems. Overall, 2-Methoxy-5-(trifluoromethyl)benzoic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications and unique structural features.

Formula: C₉H₇F₃O₃

InChI: InChI=1/C9H7F3O3/c1-15-7-3-2-5(9(10,11)12)4-6(7)8(13)14/h2-4H,1H3,(H,13,14)

SMILES: COc1ccc(cc1C(=O)O)C(F)(F)F

Synonyms:

• 4864-01-1
• Qvr Bo1 Exfff
• 2-Methoxy-5-(trifluoromethyl)benzoic acid

2-Methoxy-5-(trifluoromethyl)benzoic acid

CAS: 4864-01-1

Formula: C₉H₇F₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 220.1453

Ref: IN-DA003HJ5

2-Methoxy-5-(trifluoromethyl)benzoic acid

CAS: 4864-01-1

2-Methoxy-5-(trifluoromethyl)benzoic acid

Formula: C₉H₇F₃O₃

Purity: 98%

Color and Shape: White Solid

Molecular weight: 220.15g/mol

Ref: 54-PC5709

2-Methoxy-5-(trifluoromethyl)benzoic acid

CAS: 4864-01-1

Formula: C₉H₇F₃O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 220.147

Ref: 10-F045020