CAS 486424-36-6
:4-Bromo-2,5-difluorophenol
Description:
4-Bromo-2,5-difluorophenol is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) and halogen substituents on the aromatic ring. Specifically, it features a bromine atom at the para position and two fluorine atoms at the ortho positions relative to the hydroxyl group. This substitution pattern influences its chemical reactivity and physical properties, such as solubility and boiling point. The compound is typically a solid at room temperature and may exhibit moderate to high polarity due to the electronegative halogens and the hydroxyl group. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the presence of halogens can enhance its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-2,5-difluorophenol is a valuable compound in various chemical applications due to its unique structural features.
Formula:C6H3BrF2O
InChI:InChI=1S/C6H3BrF2O/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H
InChI key:InChIKey=BYZMZJIWCQTYSR-UHFFFAOYSA-N
SMILES:BrC1=C(F)C=C(O)C(F)=C1
Synonyms:- 1-Hydroxy-4-bromo-2,5-difluorobenzene
- 486424-36-6
- Phenol, 4-bromo-2,5-difluoro-
- Qr Bf Ef De
- 4-Bromo-2,5-difluorophenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Bromo-2,5-difluorophenol, 99%
CAS:4-Bromo-2,5-difluorophenol is used as a raw material in organic synthesis. Used in the synthesis allyloxy-based biphenyl liquid crystals with multiple lateral fluoro substituents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentatiFormula:C6H3BrF2OPurity:99%Color and Shape:White to cream or pale purple, Crystals or powder or crystalline powder or flakes or lumpy/fused solid or chunksMolecular weight:208.994-Bromo-2,5-difluorophenol
CAS:Formula:C6H3BrF2OPurity:97%Color and Shape:SolidMolecular weight:208.98824-Bromo-2,5-difluorophenol
CAS:4-Bromo-2,5-difluorophenolFormula:C6H3BrF2OPurity:98%Color and Shape: pale lemon/cream. wooly crystalline needlesMolecular weight:208.99g/mol4-Bromo-2,5-difluorophenol
CAS:Formula:C6H3BrF2OPurity:97%Color and Shape:SolidMolecular weight:208.99



