CAS 486424-37-7
:3-Amino-6-bromo-2-pyrazinecarboxylic acid
Description:
3-Amino-6-bromo-2-pyrazinecarboxylic acid is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a bromo substituent (-Br) at specific positions on the pyrazine ring, along with a carboxylic acid group (-COOH) that contributes to its acidic properties. The presence of these functional groups imparts both polar and hydrophilic characteristics, making it soluble in polar solvents. The compound is of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing other complex molecules. Its structure allows for various chemical modifications, which can enhance its reactivity and application in drug development or as a building block in organic synthesis. Additionally, the bromine atom can serve as a site for further substitution reactions, expanding its utility in synthetic pathways. Overall, 3-Amino-6-bromo-2-pyrazinecarboxylic acid is a versatile compound with significant implications in various fields of chemistry.
Formula:C5H4BrN3O2
InChI:InChI=1S/C5H4BrN3O2/c6-2-1-8-4(7)3(9-2)5(10)11/h1H,(H2,7,8)(H,10,11)
InChI key:InChIKey=MTNAQEKMSVDTAQ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=NC=C(Br)N1
Synonyms:- 2-Amino-5-bromopyrazine-3-carboxylic acid
- 2-Pyrazinecarboxylic Acid, 3-Amino-6-Bromo-
- 3-Amino-6-Bromopyrazine-2-Carboxylic
- 3-Amino-6-bromo-2-pyrazinecarboxylic acid
- Acid
- Pyrazinecarboxylic acid, 3-amino-6-bromo-
- 3-Amino-6-bromopyrazine-2-carboxylic acid
- 3-Amino-6-bromopyrazine-2-carboxylic acid
- 3-amino-6-bromopyrazine-2-carboxylic
- acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Amino-6-bromopyrazine-2-carboxylic acid
CAS:Formula:C5H4BrN3O2Purity:95%Color and Shape:SolidMolecular weight:218.00823-Amino-6-bromopyrazine-2-carboxylic acid
CAS:3-Amino-6-bromopyrazine-2-carboxylic acidFormula:C5H4BrN3O2Purity:≥95%Color and Shape: khaki to mustard powderMolecular weight:218.01g/mol2-Amino-5-bromopyrazine-3-carboxylic acid
CAS:2-Amino-5-bromopyrazine-3-carboxylic acid is an organic compound that belongs to the group of boronic acids. It has a molecular weight of 138.14 and a melting point of 198°C. The compound has been characterized by x-ray crystallography, revealing its molecular structure. 2-Amino-5-bromopyrazine-3-carboxylic acid is soluble in water and can be isolated from the reaction mixture using conventional methods such as recrystallization. The compound reacts with alkyl halides through cross coupling reactions to form pyridyl compounds. This reagent is used for Suzuki, Miyaura, and other cross coupling reactions with high yield.Formula:C5H4BrN3O2Purity:Min. 95%Color and Shape:Brown PowderMolecular weight:218.01 g/mol3-Amino-6-bromopyrazine-2-carboxylic acid
CAS:Formula:C5H4BrN3O2Purity:95%Color and Shape:SolidMolecular weight:218.012-Amino-5-bromopyrazine-3-carboxylic Acid
CAS:Controlled ProductApplications 2-Amino-5-bromopyrazine-3-carboxylic Acid (cas# 486424-37-7) is a compound useful in organic synthesis.
Formula:C5H4BrN3O2Color and Shape:NeatMolecular weight:218.01




