CAS 486449-65-4

4-(6-fluoro-3-oxo-1,3-dihydro-2H-pyrazolo[4,3-c]quinolin-2-yl)benzoato(4-)

Description:

The chemical substance known as 4-(6-fluoro-3-oxo-1,3-dihydro-2H-pyrazolo[4,3-c]quinolin-2-yl)benzoate, with the CAS number 486449-65-4, is characterized by its complex molecular structure, which includes a pyrazoloquinoline core and a benzoate moiety. This compound features a fluorine atom, contributing to its unique electronic properties and potential biological activity. The presence of the keto group (3-oxo) indicates that it may participate in various chemical reactions, including nucleophilic attacks or hydrogen bonding. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's solubility, stability, and reactivity would depend on its functional groups and the overall molecular architecture. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a class of heterocyclic compounds that may exhibit interesting pharmacological properties, warranting further investigation.

Formula: C₁₇H₁₀FN₃O₃

InChI: InChI=1/C17H10FN3O3/c18-13-3-1-2-11-14-12(8-19-15(11)13)16(22)21(20-14)10-6-4-9(5-7-10)17(23)24/h1-8,20H,(H,23,24)

SMILES: c1cc2c3c(cnc2c(c1)F)c(=O)n(c1ccc(cc1)C(=O)O)[nH]3

CD80-IN-3

CAS: 486449-65-4

CD80-IN-3 is a potent CD80 inhibitor and inhibits CD80/CD28 interaction (Kd: 125 nM; EC50: 630 nM).

Formula: C₁₇H₁₀FN₃O₃

Purity: 98.08%

Color and Shape: Solid

Molecular weight: 323.28

Ref: TM-T10722

CD80-IN-3

CAS: 486449-65-4

Formula: C₁₇H₁₀FN₃O₃

Purity: 98%

Molecular weight: 323.278

Ref: IN-DA01V6UC

4-(6-Fluoro-3-Oxo-3,5-Dihydro-2H-Pyrazolo[4,3-C]Quinolin-2-Yl)Benzoic Acid

CAS: 486449-65-4

4-(6-Fluoro-3-Oxo-3,5-Dihydro-2H-Pyrazolo[4,3-C]Quinolin-2-Yl)Benzoic Acid

Purity: 98%

Molecular weight: 323.28g/mol

Ref: 54-PC108415

CD80-IN-3

CAS: 486449-65-4

CD80-IN-3

Purity: ≥95%

Molecular weight: 323.28g/mol

Ref: 54-BUP02418