CAS 486993-06-0: 2-(2-Bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide

Description: 2-(2-Bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide, with the CAS number 486993-06-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a brominated phenyl group, an ethoxy substituent, and a trifluoromethyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the acetamide functional group suggests it may engage in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the trifluoromethyl group is known for enhancing lipophilicity and biological activity, making this compound of interest in medicinal chemistry and drug development. Its unique combination of functional groups may also impart specific pharmacological properties, warranting further investigation into its potential applications in therapeutic contexts. As with many synthetic compounds, safety data and handling precautions should be considered due to the presence of bromine and trifluoromethyl groups, which can pose environmental and health risks.

Formula: C₁₈H₁₅BrF₃NO₄

InChI: InChI=1S/C18H15BrF3NO4/c1-2-26-15-7-11(9-24)6-14(19)17(15)27-10-16(25)23-13-5-3-4-12(8-13)18(20,21)22/h3-9H,2,10H2,1H3,(H,23,25)

InChI key: InChIKey=FJLBMICFSHAOOD-UHFFFAOYSA-N

SMILES: O=CC=1C=C(Br)C(OCC(=O)NC2=CC=CC(=C2)C(F)(F)F)=C(OCC)C1

Synonyms:

• 2-(2-Bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide
• Acetamide, 2-(2-bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]-

2-(2-Bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide

CAS: 486993-06-0

Please enquire for more information about 2-(2-Bromo-6-ethoxy-4-formylphenoxy)-N-[3-(trifluoromethyl)phenyl]acetamide including the price, delivery time and more detailed …

• Formula: C₁₈H₁₅BrF₃NO₄
• Purity: Min. 95%
• Molecular weight: 446.2 g/mol