CAS 486997-65-3

3-chloro-5-[(4-chlorobenzyl)sulfinyl]-1,2,4-thiadiazole

Description:

3-Chloro-5-[(4-chlorobenzyl)sulfinyl]-1,2,4-thiadiazole is a chemical compound characterized by its unique structure, which includes a thiadiazole ring, a chlorine atom, and a sulfinyl group attached to a benzyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the thiadiazole ring, which is known for its role in pharmaceuticals and agrochemicals. The sulfinyl group may enhance its reactivity and solubility in various solvents, making it suitable for applications in medicinal chemistry. The presence of chlorine atoms can influence the compound's electronic properties and stability, potentially affecting its interaction with biological targets. Additionally, the compound may exhibit antimicrobial or antifungal properties, which are common in thiadiazole derivatives. Overall, 3-chloro-5-[(4-chlorobenzyl)sulfinyl]-1,2,4-thiadiazole represents a class of compounds with diverse applications in research and industry, particularly in the development of new therapeutic agents.

Formula: C₉H₆Cl₂N₂OS₂

InChI: InChI=1/C9H6Cl2N2OS2/c10-7-3-1-6(2-4-7)5-16(14)9-12-8(11)13-15-9/h1-4H,5H2

SMILES: c1cc(ccc1CS(=O)c1nc(Cl)ns1)Cl

Synonyms:

• 1,2,4-Thiadiazole, 3-chloro-5-[[(4-chlorophenyl)methyl]sulfinyl]-
• 3-Chloro-5-[(4-chlorobenzyl)sulfinyl]-1,2,4-thiadiazole

3-Chloro-5-[(4-chlorophenyl)methanesulfinyl]-1,2,4-thiadiazole

CAS: 486997-65-3

3-Chloro-5-[(4-chlorophenyl)methanesulfinyl]-1,2,4-thiadiazole is an inhibitor of lipid kinases that is used to treat metabolic disorders and cancer. It also has neuroprotective effects and can be used to treat degenerative diseases. 3-Chloro-5-[(4-chlorophenyl)methanesulfinyl]-1,2,4-thiadiazole inhibits the growth of bacteria by binding to their cell membranes and causing them to leak. This drug has been shown to be effective against a number of microorganisms, including Bacillus subtilis, Escherichia coli, Pseudomonas aeruginosa, Staphylococcus aureus, Enterococcus faecalis, Klebsiella pneumoniae and Proteus mirabilis. The concentration of 3-Chloro-5-[(4-chlorophenyl)

Formula: C₉H₆Cl₂N₂OS₂

Purity: Min. 95%

Molecular weight: 293.2 g/mol

Ref: 3D-LUA99765