CAS 487-39-8
:4-[(1S,3aR,4R,6aR)-4-(3,4-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2-methoxyphenol
Description:
The chemical substance known as "4-[(1S,3aR,4R,6aR)-4-(3,4-dimethoxyphenyl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-2-methoxyphenol," with the CAS number 487-39-8, is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including methoxy and phenolic groups, which contribute to its chemical reactivity and potential biological activity. The presence of a tetrahydrofurofuran moiety suggests that it may exhibit interesting stereochemical properties due to its chiral centers. This compound is likely to be soluble in organic solvents, and its molecular structure may impart specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the methoxy groups can enhance lipophilicity, potentially influencing its pharmacokinetic properties. Overall, this compound's intricate structure and functional groups suggest it may have applications in pharmaceuticals or as a research chemical, although specific biological activities would require further investigation.
Formula:C21H24O6
InChI:InChI=1/C21H24O6/c1-23-17-7-5-13(9-19(17)25-3)21-15-11-26-20(14(15)10-27-21)12-4-6-16(22)18(8-12)24-2/h4-9,14-15,20-22H,10-11H2,1-3H3/t14-,15-,20+,21-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Phillygenin
CAS:Phillyrin, (+)-Phillygenin, and (-)-phillygenin exert the strongest inhibitory activities on NO production with IC(50) values.Formula:C21H24O6Purity:95%~99%Molecular weight:372.417Phillygenin
CAS:1. Phillyrin, (+)-Phillygenin (Sylvatesmin), and (-)-phillygenin exert the strongest inhibitory activities on NO production with IC(5) values.Formula:C21H24O6Purity:98.3% - 99.141%Color and Shape:SolidMolecular weight:372.41(+)-Sylvatesmin
CAS:<p>(+)-Sylvatesmin is a type of arylnaphthalene lignan, which is a naturally occurring organic compound. It is derived from certain coniferous trees and is typically found as a secondary metabolite within these plants. These lignans are known for their complex polyphenolic structures, which are biosynthesized from phenylpropanoid precursors.</p>Formula:C21H24O6Purity:Min. 95%Color and Shape:PowderMolecular weight:372.41 g/mol(+)-Sylvatesmin
CAS:Controlled Product<p>Applications (+)-Sylvatesmin (CAS# 487-39-8) is a useful research chemical compound.<br></p>Formula:C21H24O6Color and Shape:NeatMolecular weight:372.412






