CAS 487-49-0: 1-(2,4-dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone
Description:1-(2,4-Dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone, also known by its CAS number 487-49-0, is an organic compound characterized by its complex aromatic structure. This substance features a ketone functional group, which is indicated by the ethanone moiety, and two phenolic groups, one of which has hydroxyl substituents at the 2 and 4 positions, enhancing its reactivity and potential for hydrogen bonding. The presence of the methoxy group on the second phenyl ring contributes to its overall stability and solubility in organic solvents. This compound is often studied for its potential biological activities, including antioxidant properties, due to the presence of multiple hydroxyl groups. Its molecular structure allows for various interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Additionally, its physical properties, such as melting point and solubility, can vary based on the purity and specific conditions under which it is analyzed.
Formula:C15H14O4
InChI:InChI=1S/C15H14O4/c1-19-12-5-2-10(3-6-12)8-14(17)13-7-4-11(16)9-15(13)18/h2-7,9,16,18H,8H2,1H3
InChI key:InChIKey=XHBZOAYMBBUURD-UHFFFAOYSA-N
SMILES:O=C(C1=CC=C(O)C=C1O)CC2=CC=C(OC)C=C2
- Synonyms:
- 1-(2,4-Dihydroxyphenyl)-2-(4-methoxyphenyl)ethan-1-one
- 2,4-Dihydroxyphenyl 4′-methoxybenzyl ketone
- Acetophenone, 2',4'-dihydroxy-2-(p-methoxyphenyl)-
- Acetophenone, 2′,4′-dihydroxy-2-(p-methoxyphenyl)-
- Ethanone, 1-(2,4-Dihydroxyphenyl)-2-(4-Methoxyphenyl)-
- NSC 89759
- Ononetin
- α-(4-Methoxyphenyl)-2,4-dihydroxyacetophenone
- 1-(2,4-Dihydroxyphenyl)-2-(4-methoxyphenyl)ethanone
