CAS 4871-97-0: (-)-Curcumol
Description:(-)-Curcumol is a natural sesquiterpene compound primarily derived from various species of the Curcuma genus, particularly Curcuma longa, commonly known as turmeric. It is characterized by its bicyclic structure, which contributes to its unique chemical properties. The compound exhibits a pale yellow to colorless appearance and is known for its aromatic, earthy scent. (-)-Curcumol has garnered attention in the field of medicinal chemistry due to its potential pharmacological activities, including anti-inflammatory, antioxidant, and anticancer properties. Its mechanism of action is thought to involve modulation of various signaling pathways, making it a subject of interest for further research in therapeutic applications. Additionally, (-)-Curcumol is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and efficacy in biological systems. As a naturally occurring compound, it is also considered for its safety profile, although further studies are necessary to fully understand its effects and potential uses in medicine and health.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h9,11-13,16H,3,5-8H2,1-2,4H3/t11-,12-,13-,14-,15+/m0/s1
InChI key:InChIKey=QRMPRVXWPCLVNI-YYFQZIEXSA-N
SMILES:OC12OC3(CC1C(C)C)C(C(=C)C2)CCC3C
- Synonyms:
- (3S,3aS,5S,6R,8aS)-Octahydro-3-methyl-8-methylene-5-(1-methylethyl)-6H-3a,6-epoxyazulen-6-ol
- (3S,3aS,5S,8aS)-3-methyl-8-methylidene-5-(propan-2-yl)octahydro-6H-3a,6-epoxyazulen-6-ol
- (3S,5S,6S,8aS)-3-methyl-8-methylidene-5-(propan-2-yl)octahydro-6H-3a,6-epoxyazulen-6-ol
- 5β-Guai-10(14)-en-8-ol, 5,8-epoxy-, (-)-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-3-methyl-8-methylene-5-(1-methylethyl)-, (3S,3aS,5S,6R,8aS)-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-3-methyl-8-methylene-5-(1-methylethyl)-, [3S-(3α,3aα,5β,6β,8aβ)]-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-5-isopropyl-3-methyl-8-methylene-
- 8α-Hydroxy-1α,4α,7βH-guai-10(15)-en-5β,8β-endoxide
