CAS 4871-97-0
:(-)-Curcumol
Description:
(-)-Curcumol is a natural sesquiterpene compound primarily derived from various species of the Curcuma genus, particularly Curcuma longa, commonly known as turmeric. It is characterized by its bicyclic structure, which contributes to its unique chemical properties. The compound exhibits a pale yellow to colorless appearance and is known for its aromatic, earthy scent. (-)-Curcumol has garnered attention in the field of medicinal chemistry due to its potential pharmacological activities, including anti-inflammatory, antioxidant, and anticancer properties. Its mechanism of action is thought to involve modulation of various signaling pathways, making it a subject of interest for further research in therapeutic applications. Additionally, (-)-Curcumol is soluble in organic solvents but has limited solubility in water, which can influence its bioavailability and efficacy in biological systems. As a naturally occurring compound, it is also considered for its safety profile, although further studies are necessary to fully understand its effects and potential uses in medicine and health.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h9,11-13,16H,3,5-8H2,1-2,4H3/t11-,12-,13-,14-,15+/m0/s1
InChI key:InChIKey=QRMPRVXWPCLVNI-YYFQZIEXSA-N
SMILES:C[C@@H]1[C@@]23[C@](C(=C)C[C@@](O)(O2)[C@H]([C@@H](C)C)C3)(CC1)[H]
Synonyms:- (3S,3aS,5S,6R,8aS)-Octahydro-3-methyl-8-methylene-5-(1-methylethyl)-6H-3a,6-epoxyazulen-6-ol
- (3S,3aS,5S,8aS)-3-methyl-8-methylidene-5-(propan-2-yl)octahydro-6H-3a,6-epoxyazulen-6-ol
- (3S,5S,6S,8aS)-3-methyl-8-methylidene-5-(propan-2-yl)octahydro-6H-3a,6-epoxyazulen-6-ol
- 5β-Guai-10(14)-en-8-ol, 5,8-epoxy-, (-)-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-3-methyl-8-methylene-5-(1-methylethyl)-, (3S,3aS,5S,6R,8aS)-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-3-methyl-8-methylene-5-(1-methylethyl)-, [3S-(3α,3aα,5β,6β,8aβ)]-
- 6H-3a,6-Epoxyazulen-6-ol, octahydro-5-isopropyl-3-methyl-8-methylene-
- 8α-Hydroxy-1α,4α,7βH-guai-10(15)-en-5β,8β-endoxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Curcumol
CAS:Formula:C15H24O2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:236.36Curcumol
CAS:Curcumol ((-)-Curcumol), a pure monomer isolated extracted from Rhizoma Curcumaeis, has antitumor activities.Formula:C15H24O2Purity:98.99% - 99.87%Color and Shape:SolidMolecular weight:236.35Curcumol
CAS:Oxygen-heterocyclic compoundFormula:C15H24O2Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:236.36Curcumol
CAS:Curcumol is a bioactive compound, which is a sesquiterpenoid alcohol primarily extracted from the rhizome of the plant Curcuma wenyujin, a member of the Zingiberaceae family. The source plant is native to parts of Asia and has been traditionally used in herbal medicine. The mode of action of Curcumol involves modulation of multiple biochemical pathways, including anti-inflammatory and antioxidant pathways. It has been observed to influence cellular signaling cascades that regulate apoptosis, cell proliferation, and angiogenesis, making it a compound of interest in oncology research.
Formula:C15H24O2Purity:Min. 95%Color and Shape:PowderMolecular weight:236.35 g/mol








