CAS 4874-85-5

1,5-diphenyl-1H-1,2,3-triazole

Description:

1,5-Diphenyl-1H-1,2,3-triazole is a heterocyclic organic compound characterized by its triazole ring structure, which consists of three nitrogen atoms and two carbon atoms. This compound features two phenyl groups attached to the 1 and 5 positions of the triazole ring, contributing to its aromatic properties and enhancing its stability. It is typically a white to light yellow crystalline solid, exhibiting moderate solubility in organic solvents such as ethanol and dichloromethane. The presence of the triazole moiety imparts unique chemical reactivity, making it useful in various applications, including as a ligand in coordination chemistry and in the synthesis of pharmaceuticals and agrochemicals. Additionally, 1,5-diphenyl-1H-1,2,3-triazole may exhibit interesting biological activities, including antifungal and antimicrobial properties. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in medicinal chemistry. Overall, this compound is valued for its versatility in both synthetic and applied chemistry contexts.

Formula: C₁₄H₁₁N₃

InChI: InChI=1/C14H11N3/c1-3-7-12(8-4-1)14-11-15-16-17(14)13-9-5-2-6-10-13/h1-11H

SMILES: c1ccc(cc1)c1cnnn1c1ccccc1

1,5-Diphenyl-1h-1,2,3-triazole

CAS: 4874-85-5

Formula: C₁₄H₁₁N₃

Purity: 98%

Molecular weight: 221.2572

Ref: IN-DA006WBJ

1,5-Diphenyl-1H-1,2,3-triazole

CAS: 4874-85-5

1,5-Diphenyl-1H-1,2,3-triazole

Purity: 98%

Molecular weight: 221.26g/mol

Ref: 54-OR1005278

1,5-Diphenyl-1H-1,2,3-triazole

CAS: 4874-85-5

Purity: 95+%

Molecular weight: 221.26300048828125

Ref: 10-F750409

1,5-Diphenyl-1,2,3-triazole

CAS: 4874-85-5

1,5-Diphenyl-1,2,3-triazole is a hydrogen bond acceptor that can coordinate to metal ions. It has been shown to have anti-infective properties in the form of an interaction with the CB1 cannabinoid receptor. The supramolecular chemistry of 1,5-diphenyl-1,2,3-triazole has also been studied. In this type of study, the molecule's interactions are investigated through its supramolecular assembly with other molecules. This compound is also used as a precursor for the synthesis of other molecules.

Formula: C₁₄H₁₁N₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 221.26 g/mol

Ref: 3D-FD66521