CymitQuimica logo

CAS 4878-36-8

:

3,5-diamino-6-chloropyrazine-2-carboxylic acid

Description:
3,5-Diamino-6-chloropyrazine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrazine ring structure, which contains two amino groups and a carboxylic acid functional group. The presence of chlorine at the 6-position of the pyrazine ring contributes to its reactivity and potential applications in various chemical syntheses. This compound is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its amino groups can participate in further chemical reactions, making it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. The compound's unique structure allows it to exhibit biological activity, which may be of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests potential for diverse chemical modifications, enhancing its utility in research and industrial applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H5ClN4O2
InChI:InChI=1/C5H5ClN4O2/c6-2-4(8)10-3(7)1(9-2)5(11)12/h(H,11,12)(H4,7,8,10)
InChI key:OCSQJDAUOOHJEI-UHFFFAOYSA-N
SMILES:c1(c(N)nc(c(Cl)n1)N)C(=O)O
Synonyms:
  • 2-Pyrazinecarboxylic Acid, 3,5-Diamino-6-Chloro-
  • 3,5-Diamino-6-chloro-2-pyrazinecarboxylic acid
  • 3,5-Diamino-6-chloropyrazinecarbonic acid
  • Acide 3,5-diamino-6-chloropyrazine-2-carboxylique
  • 3,5-Diamino-6-chloropyrazine-2-carboxylic acid
Found 8 products.