CAS 488-44-8: Allitol
Description:Allitol, with the CAS number 488-44-8, is a sugar alcohol that is derived from the reduction of sugars, specifically D-mannitol. It is a white crystalline solid that is soluble in water, making it suitable for various applications in the food and pharmaceutical industries. Allitol is known for its sweet taste, which is similar to that of sucrose, but it has a lower caloric value, making it a popular choice as a sugar substitute in low-calorie and sugar-free products. Additionally, it exhibits humectant properties, helping to retain moisture in food products. Allitol is non-cariogenic, meaning it does not contribute to tooth decay, which adds to its appeal as a sweetener. Its safety profile is generally regarded as favorable, with minimal gastrointestinal side effects compared to other sugar alcohols. Overall, allitol serves as a versatile ingredient in various formulations, contributing both sweetness and functional benefits.
Formula:C6H14O6
InChI:InChI=1/C6H14O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3-12H,1-2H2/t3-,4+,5-,6+
InChI key:InChIKey=FBPFZTCFMRRESA-FBXFSONDNA-N
SMILES:OCC(O)C(O)C(O)C(O)CO
- Synonyms:
- Allit
- Allodulcit
- Allodulcitol
- Allitol
