CAS 4880-04-0
:2-Propenoic acid, 2-methyl-, pentamethyldisiloxanyl ester
Description:
2-Propenoic acid, 2-methyl-, pentamethyldisiloxanyl ester, commonly known by its CAS number 4880-04-0, is an organic compound that belongs to the class of acrylate esters. This substance features a propenoic acid backbone with a methyl group at the second carbon, enhancing its reactivity and solubility in various organic solvents. The presence of the pentamethyldisiloxanyl group introduces siloxane characteristics, which can impart unique properties such as increased thermal stability, flexibility, and hydrophobicity. This compound is typically used in polymer chemistry, particularly in the synthesis of silicone-based materials and coatings, due to its ability to undergo polymerization. Its structure allows for potential applications in adhesives, sealants, and surface treatments. Additionally, the compound may exhibit low volatility and good compatibility with other materials, making it suitable for various industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H20O3Si2
InChI:InChI=1S/C9H20O3Si2/c1-8(2)9(10)11-14(6,7)12-13(3,4)5/h1H2,2-7H3
InChI key:InChIKey=HWZPCWIHVLRGII-UHFFFAOYSA-N
SMILES:O([Si](O[Si](C)(C)C)(C)C)C(C(C)=C)=O
Synonyms:- 2-Propenoic acid, 2-methyl-, pentamethyldisiloxanyl ester
- Disiloxanol, pentamethyl-,methacrylate
- Methacrylic acid, pentamethyldisiloxanyl ester
- Methacrylicacid, pentamethyldisiloxanyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pentamethyldisiloxanyl methacrylate
CAS:<p>S12880 - Pentamethyldisiloxanyl methacrylate</p>Formula:C9H20O3Si2Color and Shape:ClearMolecular weight:232.426
