CAS 488085-18-3

Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-

Description:

Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[[9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]- is a complex polymeric compound characterized by its unique structure, which includes poly(ethylene glycol) segments and functional groups that enhance its reactivity and solubility. The presence of the pyrrolidinyl moiety suggests potential applications in drug delivery systems, as it may facilitate interactions with biological targets. The fluorenylmethoxycarbonyl (Fmoc) group indicates that this compound can be used in peptide synthesis and as a protecting group for amino acids, making it valuable in organic synthesis and medicinal chemistry. Its amphiphilic nature, due to the combination of hydrophilic and hydrophobic segments, allows for self-assembly into micelles or other nanostructures in solution, which can be exploited for various biomedical applications. Overall, this compound's multifunctionality and structural complexity make it a subject of interest in polymer chemistry and drug formulation research.

Formula: (C₂H₄O)nC₂₄H₂₄N₂O₇

InChI: InChI=1S/C26H28N2O8/c29-23-9-10-24(30)28(23)36-25(31)11-13-33-15-16-34-14-12-27-26(32)35-17-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-8,22H,9-17H2,(H,27,32)

InChI key: InChIKey=MLMVUZTWJNGUEN-UHFFFAOYSA-N

SMILES: C(OC(NCCOCCOCCC(ON1C(=O)CCC1=O)=O)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]-

Fmoc-N-Amido-dPEG®12-NHS Ester

CAS: 488085-18-3

Fmoc-N-Amido-dPEG®12-NHS Ester is a PEG compound with two different functional groups (also known as heterobifunctional). Unlike homobifunctional PEG compounds (same functional group on both ends), this type of compounds are more versatile as have two different anchor points. Fmoc-N-Amido-dPEG®12-NHS Ester is used as a linker and spacer to add a PEG moiety, via pegylation (a bioconjugation technique) to proteins, peptides, oligonucleotides, small molecules and nanoparticles.

Formula: C₄₆H₆₈N₂O₁₈

Purity: Min. 95%

Molecular weight: 937.03 g/mol

Ref: 3D-DPG-6073