CymitQuimica logo

CAS 488713-29-7

:

Pyridine, 3-chloro-2-iodo-5-nitro-

Description:
Pyridine, 3-chloro-2-iodo-5-nitro- is a heterocyclic organic compound characterized by a pyridine ring substituted with a chlorine atom, an iodine atom, and a nitro group. The presence of these substituents significantly influences its chemical properties and reactivity. The chlorine and iodine atoms introduce halogen functionalities, which can participate in nucleophilic substitution reactions, while the nitro group is a strong electron-withdrawing group that can enhance the acidity of nearby hydrogen atoms and influence the compound's electrophilic reactivity. This compound is typically a pale yellow to brown solid and is soluble in organic solvents. Its unique structure makes it of interest in various fields, including medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of more complex molecules or as a potential pharmacophore. Safety precautions should be observed when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.
Formula:C5H2ClIN2O2
InChI:InChI=1S/C5H2ClIN2O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H
InChI key:InChIKey=FCXUHIMBZWWQMB-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(Cl)C(I)=NC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.