CAS 488832-69-5
:Elesclomol
Description:
Elesclomol is a synthetic small molecule that has garnered attention for its potential as an anti-cancer agent. It functions primarily as an oxidative stress inducer, selectively targeting cancer cells by enhancing their oxidative metabolism, which can lead to apoptosis. Elesclomol is characterized by its ability to increase reactive oxygen species (ROS) levels within tumor cells, thereby exploiting the heightened oxidative stress that many cancer cells experience. This mechanism is thought to be particularly effective in certain types of cancers, including melanoma. The compound is typically administered intravenously and has been studied in various clinical trials to evaluate its efficacy and safety profile. In terms of chemical properties, Elesclomol is a lipophilic compound, which influences its distribution and bioavailability in biological systems. Its development has been associated with both monotherapy and combination therapy approaches, aiming to enhance the therapeutic outcomes in cancer treatment. However, further research is ongoing to fully understand its mechanisms and optimize its clinical applications.
Formula:C19H20N4O2S2
InChI:InChI=1S/C19H20N4O2S2/c1-22(18(26)14-9-5-3-6-10-14)20-16(24)13-17(25)21-23(2)19(27)15-11-7-4-8-12-15/h3-12H,13H2,1-2H3,(H,20,24)(H,21,25)
InChI key:InChIKey=BKJIXTWSNXCKJH-UHFFFAOYSA-N
SMILES:C(N(NC(CC(NN(C(=S)C1=CC=CC=C1)C)=O)=O)C)(=S)C2=CC=CC=C2
Synonyms:- 1,3-Bis[2-methyl-2-(phenylthioxomethyl)hydrazide]propanedioic acid
- 1-N′,3-N′-Bis(benzenecarbonothioyl)-1-N′,3-N′-dimethylpropanedihydrazide
- Gsk 842879A
- N'~1~,N'~3~-dimethyl-N'~1~,N'~3~-bis(phenylcarbothioyl)propanedihydrazide
- NSC 174939
- Propanedioic acid, 1,3-bis[2-methyl-2-(phenylthioxomethyl)hydrazide]
- Propanedioic acid, bis[2-methyl-2-(phenylthioxomethyl)hydrazide]
- Sta 4783
- Elesclomol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N'1,N'3-Dimethyl-N'1,N'3-Di(Phenylcarbonothioyl)Malonohydrazide
CAS:N'1,N'3-Dimethyl-N'1,N'3-Di(Phenylcarbonothioyl)MalonohydrazidePurity:98%Molecular weight:400.52g/molElesclomol
CAS:Elesclomol (STA-4783) is an oxidative stress inducer and a highly lipophilic copper ion carrier.Formula:C19H20N4O2S2Purity:97.17% - 99.51%Color and Shape:SolidMolecular weight:400.52Elesclomol
CAS:Elesclomol is an investigational anticancer agent, which is a small-molecule compound. It functions by targeting the cellular oxidative stress pathway; specifically, it enhances the production of reactive oxygen species (ROS) within cancer cells. By elevating ROS levels beyond the threshold tolerable by cancer cells, Elesclomol induces apoptosis through the disruption of mitochondrial function, making it selective for environments with heightened oxidative stress.Formula:C19H20N4O2S2Purity:Min. 95%Color and Shape:PowderMolecular weight:400.52 g/mol




