CAS 489-50-9
:Fumarprotocetraric acid
Description:
Fumarprotocetraric acid is a naturally occurring lichen compound classified as a depside, which is a type of secondary metabolite. It is primarily found in various lichen species, particularly those belonging to the genus Cladonia. This compound is characterized by its unique chemical structure, which includes a combination of aromatic and aliphatic components, contributing to its biological activity. Fumarprotocetraric acid exhibits potential antioxidant properties and has been studied for its effects on various biological systems. It is soluble in polar solvents, which facilitates its extraction from lichen sources. The compound has garnered interest in the fields of pharmacology and natural product chemistry due to its potential therapeutic applications. Additionally, its presence in lichens highlights the ecological significance of these organisms in producing bioactive compounds. As with many natural products, further research is needed to fully understand its mechanisms of action and potential uses in medicine or industry.
Formula:C22H16O12
InChI:InChI=1S/C22H16O12/c1-8-5-12(24)10(6-23)19-15(8)22(31)34-20-11(7-32-14(27)4-3-13(25)26)17(28)16(21(29)30)9(2)18(20)33-19/h3-6,24,28H,7H2,1-2H3,(H,25,26)(H,29,30)/b4-3+
InChI key:InChIKey=VEGGRTFDFMUBPD-ONEGZZNKSA-N
SMILES:CC1=C2C(=C(COC(/C=C/C(O)=O)=O)C(O)=C1C(O)=O)OC(=O)C=3C(O2)=C(C=O)C(O)=CC3C
Synonyms:- 11H-Dibenzo[b,e][1,4]dioxepin, 2-butenedioic acid (E)- deriv.
- 2-Butenedioic acid (2E)-, 1-[(7-carboxy-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-9-yl)methyl] ester
- 2-Butenedioic acid (2E)-, mono[(7-carboxy-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-9-yl)methyl] ester
- 2-Butenedioic acid (E)-, mono[(7-carboxy-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-9-yl)methyl] ester
- 9-({[(2E)-3-carboxyprop-2-enoyl]oxy}methyl)-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepine-7-carboxylic acid
- 9-{[(3-carboxyacryloyl)oxy]methyl}-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepine-7-carboxylic acid
- Fumaric acid, 9-monoester with 4-formyl-3,8-dihydroxy-9-(hydroxymethyl)-1,6-dimethyl-11-oxo-11H-dibenzo[b,e][1,4]dioxepin-7-carboxylic acid
- Fumaroprotocetraric acid
- Fumarprotocetraric acid
- Isophthalaldehydic acid, 2-[(3-carboxy-α<sup>5</sup>,4,6-trihydroxy-2,5-xylyl)oxy]-4-hydroxy-6-methyl-, ε-lactone, α<sup>5</sup>-(hydrogen fumarate)
- Nsc 249984
- Nsc 685588
- ((7-Carboxy-4-formyl-3,8-dihydroxy-1,6-dimethyl-11-oxo-11H-dibenzo(b,e)(1,4)dioxepin-9-yl)methyl) hydrogen fumarate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Fumarprotocetraric acid
CAS:LactoneFormula:C22H16O12Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:472.36Fumarprotocetraric acid
CAS:Fumarprotocetraric acid is a depsidone compound, which is a type of secondary metabolite. This compound is derived primarily from lichen species, where it serves various ecological functions, such as deterring herbivory and microbial attacks due to its bioactive properties. The mode of action of fumarprotocetraric acid includes the ability to interact with biological membranes, potentially disrupting microbial cell walls or modulating enzymatic activities within cells. Its molecular structure allows it to engage in hydrogen bonding and hydrophobic interactions, contributing to its biological efficacy.Formula:C22H16O12Purity:Min. 95%Color and Shape:PowderMolecular weight:472.36 g/mol

