CAS 489-72-5
:(7R,7aR,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-6-one
Description:
The chemical substance known as (7R,7aR,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-6-one, with the CAS number 489-72-5, is a complex bicyclic compound featuring a unique arrangement of nitrogen and carbon atoms. This compound is characterized by its fused ring structure, which includes two pyridine-like rings and a diazocin framework. The stereochemistry indicated by the R and S designations suggests specific spatial arrangements of substituents around the chiral centers, which can significantly influence its chemical behavior and biological activity. The presence of the methano bridge contributes to the rigidity of the structure, while the dodecahydro designation indicates a fully saturated system, implying that it is likely to be stable under standard conditions. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its unique structure and potential biological activity warrant further investigation to explore its applications in various fields.
Formula:C15H24N2O
InChI:InChI=1S/C15H24N2O/c18-15-12-9-11(13-5-2-4-8-17(13)15)10-16-7-3-1-6-14(12)16/h11-14H,1-10H2/t11-,12+,13-,14+/m0/s1
InChI key:InChIKey=YQMWQSMYVPLYDI-RFQIPJPRSA-N
SMILES:O=C1[C@]2([C@@]3(N(C[C@](C2)([C@]4(N1CCCC4)[H])[H])CCCC3)[H])[H]
Synonyms:- (7R,7aR,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-6-one
- 17-Oxosparteine
- 7,14-Methano-2H,6H-dipyrido(1,2-a:1',2'-e)(1,5)diazocin-6-one, dodecahydro-, (7R-(7alpha,7aalpha,14alpha,14abeta))- (9CI)
- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-6-one, dodecahydro-, (7R,7aR,14S,14aS)-
- 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-6-one, dodecahydro-, [7R-(7α,7aα,14α,14aβ)]-
- L-Oxysparteine
- Nsc 127496
- Oxosparteine
- Spartein-10-One
- Spartein-17-One
- Sparteine, 17-Oxo-
- l-17-Oxosparteine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
17-Oxosparteine
CAS:17-Oxosparteine is a minor urinary metabolite of sparteine in man.Formula:C15H24N2OColor and Shape:SolidMolecular weight:248.36
