CAS 489-76-9: 6-(hydroxymethyl)-9-methoxyphenazine-1-carboxylic acid

Description:6-(Hydroxymethyl)-9-methoxyphenazine-1-carboxylic acid, with the CAS number 489-76-9, is a chemical compound belonging to the phenazine family, characterized by its unique structure that includes a phenazine core substituted with various functional groups. This compound features a hydroxymethyl group and a methoxy group, which contribute to its solubility and reactivity. It is typically a solid at room temperature and may exhibit moderate stability under standard conditions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may act as a weak acid. This compound is of interest in various fields, including organic synthesis and medicinal chemistry, due to its potential biological activities. Its derivatives may exhibit antimicrobial or antitumor properties, making it a subject of research in pharmacology. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula:C₁₅H₁₂N₂O₄

InChI:InChI=1/C15H12N2O4/c1-21-11-6-5-8(7-18)12-14(11)17-13-9(15(19)20)3-2-4-10(13)16-12/h2-6,18H,7H2,1H3,(H,19,20)