CAS 4894-34-2

4-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde

Description:

4-Methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde, with the CAS number 4894-34-2, is a heterocyclic organic compound characterized by its pyrrolopyridine structure. This compound features a fused bicyclic system that includes both pyrrole and pyridine rings, contributing to its unique chemical properties. The presence of a methyl group at the 4-position and an aldehyde functional group at the 3-position enhances its reactivity and potential for further chemical modifications. Typically, compounds of this class exhibit biological activity, making them of interest in medicinal chemistry and drug development. The aldehyde group can participate in various reactions, such as condensation and reduction, while the nitrogen atoms in the heterocyclic rings can engage in coordination with metal ions or participate in hydrogen bonding. Additionally, the compound's solubility and stability can vary depending on the solvent and environmental conditions, influencing its applications in research and industry. Overall, 4-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde is a versatile compound with significant potential in various chemical and pharmaceutical contexts.

Formula: C₉H₁₀N₂O

InChI: InChI=1/C9H10N2O/c1-6-2-3-10-9-8(6)7(5-12)4-11-9/h4-5H,2-3H2,1H3,(H,10,11)

SMILES: CC1=c2c(c[nH]c2=NCC1)C=O

1H-PYRROLO[2,3-B]PYRIDINE-3-CARBOXALDEHYDE, 4-METHYL-

CAS: 4894-34-2

Formula: C₉H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.1726

Ref: IN-DA00DY56

4-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde

CAS: 4894-34-2

4-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde

Purity: 98%

Molecular weight: 160.18g/mol

Ref: 54-OR1034201

4-Methyl-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde

CAS: 4894-34-2

Formula: C₉H₈N₂O

Purity: 98%

Molecular weight: 160.176

Ref: 10-F465149