CAS 489446-42-6
:(4-{[(tert-butoxycarbonyl)amino]methyl}phenyl)boronic acid
Description:
(4-{[(tert-butoxycarbonyl)amino]methyl}phenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a tert-butoxycarbonyl (Boc) protected amino group, which enhances its stability and solubility. The boronic acid moiety contributes to its reactivity, allowing it to participate in Suzuki coupling reactions, a key method for forming carbon-carbon bonds. This compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structural features suggest potential applications in drug development, particularly in the design of inhibitors for proteases or other enzymes that interact with boron-containing compounds. Safety and handling precautions should be observed, as with all chemical substances, due to potential reactivity and toxicity.
Formula:C12H18BNO4
InChI:InChI=1/C12H18BNO4/c1-12(2,3)18-11(15)14-8-9-4-6-10(7-5-9)13(16)17/h4-7,16-17H,8H2,1-3H3,(H,14,15)
SMILES:CC(C)(C)OC(=NCc1ccc(cc1)B(O)O)O
Synonyms:- 4-[(N-BOC-Amino)methyl]phenylboronicacid
- Carbamic acid, N-[(4-boronophenyl)methyl]-, 1,1-dimethylethyl ester
- 4-((N-Boc-Amino)Methyl)Phenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Boc-aminomethyl)benzeneboronic acid, 95%
CAS:4-(Boc-aminomethyl)benzeneboronic acid is a boc protected phenyl boronic acid used for proteomics research. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alf
Formula:C12H18BNO4Purity:95%Color and Shape:White, SolidMolecular weight:251.094-(N-Boc-aminomethyl)phenylboronic acid
CAS:Formula:C12H18BNO4Purity:95%Color and Shape:SolidMolecular weight:251.08664-(Aminomethyl)benzeneboronic acid, N-BOC protected
CAS:4-(Aminomethyl)benzeneboronic acid, N-BOC protectedFormula:C12H18BNO4Purity:99%Color and Shape: off-white solidMolecular weight:251.09g/mol4-[(N-BOC-Amino)methyl]phenylboronic acid
CAS:Formula:C12H18BNO4Purity:95%Color and Shape:SolidMolecular weight:251.09




