CAS 490-11-9: Cinchomeronic acid
Description:Cinchomeronic acid, with the CAS number 490-11-9, is an organic compound that belongs to the class of carboxylic acids. It is derived from cinchona alkaloids and is characterized by its aromatic structure, which includes a fused ring system. This compound typically exhibits a white to pale yellow crystalline appearance and is known for its relatively low solubility in water, while being more soluble in organic solvents. Cinchomeronic acid is notable for its potential biological activities, including antimicrobial and anti-inflammatory properties, which have been the subject of various studies. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds, particularly in the pharmaceutical industry. The compound's stability and reactivity are influenced by the presence of functional groups, making it a subject of interest in organic synthesis and medicinal chemistry. As with many organic acids, it is important to handle cinchomeronic acid with care, following appropriate safety protocols due to its potential irritant properties.
Formula:C7H5NO4
InChI:InChI=1S/C7H5NO4/c9-6(10)4-1-2-8-3-5(4)7(11)12/h1-3H,(H,9,10)(H,11,12)
InChI key:InChIKey=MUYSADWCWFFZKR-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=NC=CC1C(=O)O
- Synonyms:
- 3,4-Pyridine Dicarboxylic Acid
- Chinchomeronic acid
- Cinchomeronic Acid Crystalline
- Cinchomeronic acid
- NSC 178
- Pyridine-3,4-Dicarboxylate
- Pyridine-3,4-dicarboxylic acid
- 3,4-Pyridinedicarboxylic acid
