CAS 490-20-0
:α-Truxillic acid
Description:
α-Truxillic acid, with the CAS number 490-20-0, is a naturally occurring organic compound classified as a bicyclic monocarboxylic acid. It is derived from the truxene structure and is characterized by its unique bicyclic framework, which includes a cyclopentene ring fused to a cyclohexene ring. This compound typically appears as a white to pale yellow crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and ether. α-Truxillic acid exhibits interesting chemical reactivity, including the ability to undergo various transformations such as esterification and decarboxylation. It has been studied for its potential applications in organic synthesis and as a building block in the development of more complex molecules. Additionally, α-Truxillic acid has garnered interest in the field of medicinal chemistry due to its structural properties, which may contribute to biological activity. Overall, its unique structure and reactivity make it a compound of interest in both academic and industrial research.
Formula:C18H16O4
InChI:InChI=1/C18H16O4/c19-17(20)15-13(11-7-3-1-4-8-11)16(18(21)22)14(15)12-9-5-2-6-10-12/h1-10,13-16H,(H,19,20)(H,21,22)/t13-,14-,15-,16-
InChI key:InChIKey=QWFRRFLKWRIKSZ-BIAGXBKMNA-N
SMILES:C(O)(=O)[C@@H]1[C@@H]([C@@H](C(O)=O)[C@H]1C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- (1α,2α,3β,4β)-2,4-Diphenyl-1,3-cyclobutanedicarboxylic acid
- 1,3-Cyclobutanedicarboxylic acid, 2,4-diphenyl-, (1α,2α,3β,4β)-
- 1,3-Cyclobutanedicarboxylic acid, 2,4-diphenyl-, cis-1,2,trans-1,3,trans-1,4-
- 1,3-Cyclobutanedicarboxylicacid, 2,4-diphenyl-, cis-1,2,trans-1,3,trans-1,4- (8CI)
- Gratissimic acid
- a-Truxillic acid
- QWFRRFLKWRIKSZ-BIAGXBKMSA-N
- Nsc103001
- .alpha.-Truxillic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
α-Truxillic acid
CAS:α-Truxillic acid, a dimer of α-trans-cinnamic acid, inhibits inflammatory pain responses.Formula:C18H16O4Purity:98%Color and Shape:SolidMolecular weight:296.32α-Truxillic acid
CAS:α-Truxillic acid is a new nonsteroidal anti-inflammatory drug that has potent antinociceptive activity. It is a derivative of the truxillic acid family and contains a hydroxyl group in the α-position. This compound has been shown to have high stability, with an optimum pH of 5.5 and particle size of less than 1 μm. α-Truxillic acid binds to the fatty acid receptor site on the cell membrane and inhibits prostaglandin synthesis by preventing phospholipase A2 from catalyzing the release of arachidonic acid from membrane phospholipids. The reaction mechanism for this inhibition was elucidated using X-ray crystal structures, molecular docking analysis, and x-ray diffraction data.Formula:C18H16O4Purity:Min. 95%Molecular weight:296.3 g/mol

