CAS 490-31-3
:Robinetin
Description:
Robinetin, with the CAS number 490-31-3, is a flavonoid compound belonging to the flavonol class. It is characterized by its yellow crystalline appearance and is primarily found in various plants, particularly in the leaves and flowers. Chemically, it is known for its antioxidant properties, which contribute to its potential health benefits, including anti-inflammatory and anti-cancer effects. Robinetin has a molecular formula that includes multiple hydroxyl groups, which enhance its reactivity and solubility in polar solvents. Its structure features a flavone backbone, which is common among flavonoids, allowing it to participate in various biochemical interactions. Additionally, Robinetin has been studied for its role in plant pigmentation and its potential applications in food and pharmaceutical industries due to its bioactive properties. Overall, Robinetin exemplifies the diverse functionalities of flavonoids in both natural and applied sciences.
Formula:C15H10O7
InChI:InChI=1S/C15H10O7/c16-7-1-2-8-11(5-7)22-15(14(21)12(8)19)6-3-9(17)13(20)10(18)4-6/h1-5,16-18,20-21H
InChI key:InChIKey=SOEDEYVDCDYMMH-UHFFFAOYSA-N
SMILES:OC1=C(OC=2C(C1=O)=CC=C(O)C2)C3=CC(O)=C(O)C(O)=C3
Synonyms:- 3,3',4',5',7-Pentahydroxyflavone
- 3,3′,4′,5′,7-Pentahydroxyflavone
- 3,7,3',4',5'-Pentahydroxuflavone
- 3,7,3′,4′,5′-Pentahydroxyflavone
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-1-benzopyran-4-one
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one
- 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-
- 4H-1-Benzopyran-4-one, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)- (9CI)
- 5-Hydroxyfisetin
- Brn 0308905
- Ccris 7520
- Flavone, 3,3',4',5',7-pentahydroxy-
- Flavone, 3,3′,4′,5′,7-pentahydroxy-
- Norkanugin
- Nsc 407331
- Nsc 656274
- Robinetin
- 3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4-benzopyrone
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Robinetin
CAS:Robinetin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C15H10O7Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:302.254H-1-Benzopyran-4-one, 3,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)
CAS:Formula:C15H10O7Purity:95%Color and Shape:SolidMolecular weight:302.2357Robinetin
CAS:Robinetin (3,3',4',5',7-Pentahydroxyflavone) has antioxidant and antiradical activities, inhibits EYPC membrane lipid peroxidation and HbA glycosylation withFormula:C15H10O7Purity:98.95% - 99.61%Color and Shape:SolidMolecular weight:302.24Robinetin
CAS:Oxygen-heterocyclic compoundFormula:C15H10O7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:302.24Robinetin
CAS:Controlled ProductApplications Robinetin (cas# 490-31-3) is a useful research chemical.
Formula:C15H10O7Color and Shape:NeatMolecular weight:302.24Robinetin
CAS:Robinetin is a flavonoid, which is a type of polyphenolic compound, isolated primarily from the black locust tree (Robinia pseudoacacia). As a naturally occurring compound, it is biosynthesized within the plant's tissues and is responsible for various physiological activities. The mode of action of Robinetin primarily involves its antioxidant properties, where it interacts with free radicals to neutralize oxidative stress, thus protecting cells from damage. Additionally, it has been observed to modulate enzyme activities and may influence signaling pathways related to inflammation and cellular responses.Formula:C15H10O7Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:302.24 g/mol3,7-Dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-4-one
CAS:Formula:C15H10O7Purity:95%Molecular weight:302.238







