CAS 490-67-5
:methyl 2-[(6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy]benzoate
Description:
Methyl 2-[(6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy]benzoate, with the CAS number 490-67-5, is a glycosylated benzoate compound characterized by the presence of a methyl ester group and two sugar moieties attached to a benzoate structure. This compound features a benzoate core, which contributes to its aromatic properties, and is further modified by the attachment of a xylopyranosyl group linked to a glucopyranosyl unit. The presence of these sugar units enhances its solubility in polar solvents and may influence its biological activity, making it of interest in various fields such as pharmacology and biochemistry. The glycosidic linkages in the structure suggest potential interactions with biological systems, possibly affecting its reactivity and stability. Additionally, the compound may exhibit specific optical activity due to the chiral centers present in the sugar components. Overall, methyl 2-[(6-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy]benzoate represents a complex structure that combines aromatic and carbohydrate chemistry, which may have implications in medicinal chemistry and natural product research.
Formula:C19H26O12
InChI:InChI=1/C19H26O12/c1-27-17(26)8-4-2-3-5-10(8)30-19-16(25)14(23)13(22)11(31-19)7-29-18-15(24)12(21)9(20)6-28-18/h2-5,9,11-16,18-25H,6-7H2,1H3/t9-,11-,12+,13-,14+,15-,16-,18+,19-/m1/s1
Synonyms:- 2-[(6-O-b-D-Xylopyranosyl-b-D-glucopyranosyl)oxy]benzoic Acid Methyl Ester
- 490-67-5
- Gaultherin
- Methyl Salicylate-2-glucoxyloside
- Methyl Salicylate-2-primeveroside
- Monotropitin
- Monotropitoside
- Methyl 2-{[6-O-(beta-D-xylopyranosyl)-beta-D-glucopyranosyl]oxy}benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((2S,3R,4S,5R)-3,4,5-trihydroxytetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)benzoate
CAS:Formula:C19H26O12Purity:95%Molecular weight:446.4025Gaultherin
CAS:<p>Gaultherin offers analgesic and anti-inflammatory effects without causing stomach ulcers, releasing salicylate slowly in the intestine.</p>Formula:C19H26O12Purity:99.85% - 99.96%Color and Shape:SolidMolecular weight:446.4Gaultherin
CAS:Natural glycosideFormula:C19H26O12Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:446.4Gaultherin
CAS:<p>Gaultherin is a glycoside compound, which is a naturally occurring product. It is derived primarily from the leaves of the Gaultheria species, such as wintergreen, and several other plant sources. The mode of action of Gaultherin involves its enzymatic hydrolysis into methyl salicylate and glucose. Methyl salicylate is a well-known analgesic and anti-inflammatory agent, acting through the inhibition of cyclooxygenase enzymes (COX), subsequently reducing the synthesis of pro-inflammatory prostaglandins.</p>Formula:C19H26O12Purity:Min. 95%Molecular weight:446.14243






