
CAS 490-93-7
:2,5-Dioxo-1,4-cyclohexanedicarboxylic acid
Description:
2,5-Dioxo-1,4-cyclohexanedicarboxylic acid, commonly referred to as 2,5-diketocyclohexane-1,4-dicarboxylic acid, is an organic compound characterized by its bicyclic structure featuring two carboxylic acid groups and two ketone functionalities. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. It has a relatively high melting point, indicative of strong intermolecular interactions, likely due to hydrogen bonding from the carboxylic acid groups. The presence of both keto and carboxylic acid functionalities allows for diverse reactivity, making it useful in organic synthesis and as an intermediate in the production of various chemical compounds. Additionally, its structural features contribute to its potential applications in pharmaceuticals and materials science. Safety data indicates that it should be handled with care, as with many organic acids, due to potential irritant properties.
Formula:C8H8O6
InChI:InChI=1S/C8H8O6/c9-5-1-3(7(11)12)6(10)2-4(5)8(13)14/h3-4H,1-2H2,(H,11,12)(H,13,14)
InChI key:InChIKey=MWOCXYMRORNPPM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C(=O)CC(C(O)=O)C(=O)C1
Synonyms:- 2,5-Dioxo-1,4-cyclohexanedicarboxylic acid
- 1,4-Cyclohexanedicarboxylic acid, 2,5-dioxo-
- Succinosuccinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
