CymitQuimica logo

CAS 490039-72-0

:

3-Cyano-4-iodopyridine

Description:
3-Cyano-4-iodopyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with both a cyano group (-C≡N) and an iodine atom (I). The presence of the cyano group imparts significant polarity and reactivity, making it useful in various chemical syntheses and applications, particularly in the field of pharmaceuticals and agrochemicals. The iodine substituent enhances the compound's electrophilic properties, facilitating nucleophilic substitution reactions. This compound typically appears as a crystalline solid and is soluble in polar organic solvents. Its molecular structure contributes to its potential as an intermediate in the synthesis of more complex molecules. Additionally, 3-cyano-4-iodopyridine may exhibit biological activity, which can be explored for medicinal chemistry applications. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed. Overall, 3-cyano-4-iodopyridine is a versatile compound with significant utility in organic synthesis and potential applications in drug development.
Formula:C6H3IN2
InChI:InChI=1/C6H3IN2/c7-6-1-2-9-4-5(6)3-8/h1-2,4H
SMILES:c1cncc(C#N)c1I
Synonyms:
  • 3-Pyridinecarbonitrile, 4-Iodo-
  • 4-Iodonicotinonitrile
  • 4-Iodopyridine-3-Carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.