CAS 4901-94-4

1,4-Dihydro-4-oxo-1,6-naphthyridine-3-carboxylic acid

Description:

1,4-Dihydro-4-oxo-1,6-naphthyridine-3-carboxylic acid, with the CAS number 4901-94-4, is a heterocyclic compound characterized by its naphthyridine structure, which consists of a fused bicyclic system containing nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the 4-oxo group indicates that it has a carbonyl functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The dihydro form suggests that the compound has two hydrogen atoms added to the naphthyridine ring, which can influence its reactivity and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility and stability in different solvents can vary, which is essential for its application in various chemical processes. Overall, 1,4-Dihydro-4-oxo-1,6-naphthyridine-3-carboxylic acid is a versatile compound with potential applications in organic synthesis and drug development.

Formula: C₉H₆N₂O₃

InChI: InChI=1S/C9H6N2O3/c12-8-5-3-10-2-1-7(5)11-4-6(8)9(13)14/h1-4H,(H,11,12)(H,13,14)

InChI key: InChIKey=XWHYSVFRPYIDHP-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC=C1C(O)=O)=CC=NC2

Synonyms:

• 1,4-Dihydro-4-oxo-1,6-naphthyridine-3-carboxylic acid
• 1,6-Naphthyridine-3-carboxylic acid, 1,4-dihydro-4-oxo-
• 4-oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid

4-Oxo-1,4-dihydro-1,6-naphthyridine-3-carboxylic acid

CAS: 4901-94-4

Versatile small molecule scaffold

Formula: C₉H₆N₂O₃

Purity: Min. 95%

Molecular weight: 190.16 g/mol

Ref: 3D-EAA90194