CAS 4906-68-7

5-bromo-4-hydroxybiphenyl-3-carboxylic acid

Description:

5-Bromo-4-hydroxybiphenyl-3-carboxylic acid, with the CAS number 4906-68-7, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom at the 5-position and a hydroxyl group at the 4-position contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. This compound may exhibit biological activity due to its structural features, which can influence interactions with biological targets. Additionally, its bromine substitution can impart unique properties, such as increased lipophilicity or altered electronic characteristics, which may be relevant in medicinal chemistry. Overall, 5-bromo-4-hydroxybiphenyl-3-carboxylic acid is a versatile compound with potential applications in various fields of chemistry and materials science.

Formula: C₁₃H₉BrO₃

InChI: InChI=1/C13H9BrO3/c14-11-7-9(8-4-2-1-3-5-8)6-10(12(11)15)13(16)17/h1-7,15H,(H,16,17)

SMILES: c1ccc(cc1)c1cc(c(c(c1)Br)O)C(=O)O

Synonyms:

• [1,1'-Biphenyl]-3-Carboxylic Acid, 5-Bromo-4-Hydroxy-

AKR1C1-IN-1

CAS: 4906-68-7

AKR1C1-IN-1 is a human 20α-hydroxysteroid dehydrogenase (AKR1C1) inhibitor (Ki: 4 nM for AKR1C1).

Formula: C₁₃H₉BrO₃

Purity: 98.62% - 99.44%

Color and Shape: Solid

Molecular weight: 293.12

Ref: TM-T14151

3-bromo-5-phenyl Salicylic Acid

CAS: 4906-68-7

Formula: C₁₃H₉BrO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 293.1128

Ref: IN-DA00DAA3

AKR1C1-IN-1

CAS: 4906-68-7

AKR1C1-IN-1

Purity: ≥98%

Molecular weight: 293.12g/mol

Ref: 54-BUP12673

AKR1C1 Inhibitor, 5-PBSA

CAS: 4906-68-7

AKR1C1 Inhibitor, 5-PBSA is a potent ATP-binding cassette transporter inhibitor. It has been shown to potently inhibit the ATP binding cassette transporter 1 (AKR1C1) in vitro and in vivo. AKR1C1 Inhibitor, 5-PBSA also inhibits the acetylation of lysine residues on histones H2B and H3 in sk-n-sh cells, which causes an inhibition of autophagy and apoptosis. This drug also has a reactive group that can be used to attach it to other compounds for targeted delivery. AKR1C1 Inhibitor, 5-PBSA has been shown to inhibit tumor growth by inhibiting tumor cell proliferation due to its ability to induce apoptosis. Chronic exposure of this drug will lead to matrix metalloproteinase degradation of collagen fibers in the extracellular matrix and an increased expression of lysine residues on histones H2B and H

Formula: C₁₃H₉BrO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 293.11 g/mol

Ref: 3D-EAA90668

5-Bromo-4-hydroxy-[1,1′-biphenyl]-3-carboxylic acid

CAS: 4906-68-7

Formula: C₁₃H₉BrO₃

Purity: ≥98%

Molecular weight: 293.116

Ref: 10-F547742