CAS 491-33-8
:8-Mercaptoquinoline
Description:
8-Mercaptoquinoline, with the CAS number 491-33-8, is an organic compound characterized by the presence of a thiol (-SH) group attached to a quinoline ring system. This compound typically appears as a yellow to brown solid and is known for its ability to form chelates with metal ions, making it useful in various applications, including analytical chemistry and coordination chemistry. The thiol group imparts significant reactivity, allowing for the formation of stable complexes with transition metals, which can be exploited in catalysis and sensor development. Additionally, 8-Mercaptoquinoline exhibits antioxidant properties and has been studied for its potential biological activities, including antimicrobial and anticancer effects. Its solubility in organic solvents and moderate stability under ambient conditions make it a versatile reagent in laboratory settings. However, like many thiols, it can be sensitive to oxidation, which may affect its reactivity and stability. Proper handling and storage conditions are essential to maintain its integrity for experimental use.
Formula:C9H7NS
InChI:InChI=1S/C9H7NS/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-6,11H
InChI key:InChIKey=MHTSJSRDFXZFHQ-UHFFFAOYSA-N
SMILES:SC=1C2=C(C=CC1)C=CC=N2
Synonyms:- 8-Mercaptoquinoline
- 8-Quinolinethiol
- Mercaptoquinoline
- NSC 102548
- NSC 48888
- Thiooxin
- Thiooxine
- Quinoline-8-thiol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

