CAS 491-50-9
:Quercetin 7-O-glucoside
Description:
Quercetin 7-O-glucoside, also known as isoquercitrin, is a flavonoid glycoside characterized by its structure, which consists of a quercetin molecule linked to a glucose moiety at the 7-position. This compound is commonly found in various plants, fruits, and vegetables, contributing to their antioxidant properties. It exhibits a range of biological activities, including anti-inflammatory, antiviral, and anticancer effects, making it of interest in nutritional and pharmaceutical research. Quercetin 7-O-glucoside is soluble in water and organic solvents, and its stability can be influenced by factors such as pH and temperature. The compound is often studied for its potential health benefits, including its role in reducing oxidative stress and supporting cardiovascular health. Additionally, it is recognized for its ability to modulate various signaling pathways, which may contribute to its therapeutic effects. Overall, Quercetin 7-O-glucoside is a significant compound in the field of natural products and health sciences.
Formula:C21H20O12
InChI:InChI=1S/C21H20O12/c22-6-13-15(26)17(28)19(30)21(33-13)31-8-4-11(25)14-12(5-8)32-20(18(29)16(14)27)7-1-2-9(23)10(24)3-7/h1-5,13,15,17,19,21-26,28-30H,6H2/t13-,15-,17+,19-,21-/m1/s1
InChI key:InChIKey=BBFYUPYFXSSMNV-HMGRVEAOSA-N
SMILES:O=C1C=2C(OC(=C1O)C3=CC(O)=C(O)C=C3)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=CC2O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5-dihydroxy-4H-1-benzopyran-4-one
- 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-4-oxo-4H-chromen-7-yl hexopyranoside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5-dihydroxy-
- NSC 115917
- Quercetin 7-O-glucoside
- Quercetin 7-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Quercetin 7-O-β-<span class="text-smallcaps">D</span>-glucoside
- Quercetin 7-O-β-glucopyranoside
- Quercetin 7-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Quercetin-7-O-beta-D-glucopyranoside
- Quercimeritrin
- Quercimeritroside
- Quercimetrin
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-7-(β-D-glucopyranosyloxy)-3,5-dihydroxy-
- C.I. 75710
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Quercetin-7-O-glucoside
CAS:Quercetin-7-O-glucoside analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C21H20O12Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:464.38Quercimeritrin
CAS:Quercimeritrin (Quercetin-7-O-beta-D-glucopyranoside) has antibacterial activity, it shows promising activity against Staphylococcus aureus.Formula:C21H20O12Purity:98.84% - 99.98%Color and Shape:SolidMolecular weight:464.38Quercetin 7-glucoside
CAS:Natural glycosideFormula:C21H20O12Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:464.38Quercetin-7-O-β-D-glucopyranoside
CAS:Quercetin-7-O-β-D-glucopyranoside is a flavonoid glycoside, which is a specialized type of bioactive compound found predominantly in various plants. Structurally, it constitutes quercetin—a well-known flavonoid—conjugated with a glucose molecule, specifically at the 7th position of the quercetin structure. This compound is primarily sourced from fruits, vegetables, and various herbs.
Formula:C21H20O12Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:464.38 g/mol







