CAS 491-58-7
:Chrysarobin
Description:
Chrysarobin, also known as chrysophanic acid or by its chemical name 1,8-dihydroxy-3-methyl-9,10-anthracenedione, is a natural compound derived from the bark of the tree *Andira araroba*. It is characterized by its yellow to orange crystalline appearance and is known for its medicinal properties, particularly in dermatology. Chrysarobin exhibits antifungal and anti-inflammatory activities, making it useful in the treatment of skin conditions such as psoriasis and eczema. The compound is soluble in organic solvents like alcohol and ether but has limited solubility in water. Its mechanism of action involves the modulation of cellular processes, which can lead to the reduction of skin cell proliferation. Additionally, chrysarobin has been studied for its potential antioxidant properties. However, it can cause skin irritation in some individuals, necessitating caution during use. As a chemical substance, it has a molecular formula of C15H10O5 and a molecular weight that reflects its complex structure, contributing to its biological activity and therapeutic applications.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c1-8-5-10-7-9-3-2-4-11(16)13(9)15(18)14(10)12(17)6-8/h2-6,16-17H,7H2,1H3
InChI key:InChIKey=ZZBWSNKBZKPGAK-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC=3C1=C(O)C=CC3)=CC(C)=CC2O
Synonyms:- Chrysothrone
- Chrysophanol anthrone
- 9(10H)-Anthracenone, 1,8-dihydroxy-3-methyl-
- Anthrone, 1,8-dihydroxy-3-methyl-
- 1,8-Dihydroxy-3-methyl-9(10H)-anthracenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
