CAS 491-74-7
:Iridin
Description:
Iridin, with the CAS number 491-74-7, is a naturally occurring chemical compound classified as a flavonoid glycoside. It is primarily derived from various plant sources, particularly those in the Iris genus. Iridin is known for its potential pharmacological properties, including anti-inflammatory and antioxidant effects, which are attributed to its flavonoid structure. The compound typically appears as a white to pale yellow crystalline solid and is soluble in polar solvents. Its molecular structure features a flavone backbone with a sugar moiety, which contributes to its biological activity and solubility profile. Iridin has been studied for its potential therapeutic applications, including its role in traditional medicine. However, further research is necessary to fully understand its mechanisms of action and efficacy in various health contexts. As with many natural compounds, the extraction and purification processes can influence its availability and concentration in different formulations.
Formula:C24H26O13
InChI:InChI=1S/C24H26O13/c1-32-13-5-9(4-11(26)22(13)33-2)10-8-35-12-6-14(23(34-3)19(29)16(12)17(10)27)36-24-21(31)20(30)18(28)15(7-25)37-24/h4-6,8,15,18,20-21,24-26,28-31H,7H2,1-3H3/t15-,18-,20+,21-,24-/m1/s1
InChI key:InChIKey=LNQCUTNLHUQZLR-OZJWLQQPSA-N
SMILES:O=C1C=2C(=CC(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)=C(OC)C2O)OC=C1C4=CC(OC)=C(OC)C(O)=C4
Synonyms:- 4H-1-Benzopyran-4-one, 7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-
- 5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 7-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
- Iridin
- Irigenin 7-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Irigenin 7-glucoside
- Irigenin 7-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Irigenin 7-β-D-glucopyranoside
- 4H-1-Benzopyran-4-one, 7-(β-D-glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-
- 7-(β-D-Glucopyranosyloxy)-5-hydroxy-3-(3-hydroxy-4,5-dimethoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Iridin
CAS:Iridin (Lridin) is major active ingredient of Iris dichotoma which could be used as the drug for pain, inflammation treatmentFormula:C24H26O13Purity:99.67% - 99.84%Color and Shape:SolidMolecular weight:522.46Iridin
CAS:Natural glycosideFormula:C24H26O13Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:522.46Iridin
CAS:Iridin is an isoflavone glycoside derived primarily from the rhizomes of certain species of the Iris plant. As a phytochemical compound, its source is botanical, particularly extracted from Iris versicolor, known commonly as the Blue Flag plant. The mode of action for Iridin involves its role as a glycoside compound, which influences various biochemical pathways in the body. Glycosides like Iridin are known for their potential to modulate enzyme activities, interact with cellular signals, and participate in the process of detoxification within the liver.Formula:C24H26O13Purity:Min. 98 Area-%Color and Shape:Off-White Yellow PowderMolecular weight:522.46 g/mol






