CAS 4914-36-7
:N-Acetylloline
Description:
N-Acetylloline, with the CAS number 4914-36-7, is a chemical compound that serves as a derivative of the neurotransmitter acetylcholine. It is characterized by the presence of an acetyl group attached to the nitrogen atom of the choline moiety. This modification can influence its biological activity and pharmacological properties. N-Acetylloline is typically a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature. It is often studied for its potential roles in neurobiology and pharmacology, particularly in relation to cholinergic signaling pathways. The compound may exhibit varying degrees of activity at acetylcholine receptors, which are critical for numerous physiological processes, including muscle contraction and neurotransmission. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, N-Acetylloline is of interest in both research and potential therapeutic applications, particularly in the context of neurological disorders.
Formula:C10H16N2O2
InChI:InChI=1S/C10H16N2O2/c1-6(13)11(2)9-8-5-12-4-3-7(14-8)10(9)12/h7-10H,3-5H2,1-2H3/t7-,8+,9-,10+/m0/s1
InChI key:InChIKey=YIZSKLHCDNIMHK-QCLAVDOMSA-N
SMILES:N(C(C)=O)(C)[C@@H]1[C@]2([C@]3(O[C@@]1(C[N@@]2CC3)[H])[H])[H]
Synonyms:- Acetamide, N-(hexahydro-2,4-methano-4H-furo[3,2-b]pyrrol-3-yl)-N-methyl-, [2R-(2α,3α,3aβ,4α,6aβ)]-
- Lolinine
- N-[(2R,3R,3aS,4S,6aS)-Hexahydro-2,4-methano-4H-furo[3,2-b]pyrrol-3-yl]-N-methylacetamide
- 2,4-Methano-4H-furo[3,2-b]pyrrole, acetamide deriv.
- Acetamide, N-[(2R,3R,3aS,4S,6aS)-hexahydro-2,4-methano-4H-furo[3,2-b]pyrrol-3-yl]-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-Acetylloline
CAS:N-Acetylloline is a derivative of loline.Formula:C10H16N2O2Color and Shape:SolidMolecular weight:196.25
